(2S,3R,4R,5R,6S)-2-[2-(aminomethyl)phenoxy]-6-methyloxane-3,4,5-triol
| Internal ID | aa8fe7fe-453b-4856-9fa7-c64622e761cc |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
| IUPAC Name | (2S,3R,4R,5R,6S)-2-[2-(aminomethyl)phenoxy]-6-methyloxane-3,4,5-triol |
| SMILES (Canonical) | CC1C(C(C(C(O1)OC2=CC=CC=C2CN)O)O)O |
| SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC2=CC=CC=C2CN)O)O)O |
| InChI | InChI=1S/C13H19NO5/c1-7-10(15)11(16)12(17)13(18-7)19-9-5-3-2-4-8(9)6-14/h2-5,7,10-13,15-17H,6,14H2,1H3/t7-,10-,11+,12+,13-/m0/s1 |
| InChI Key | ATQGYQHJFMZNGI-HPMQQCADSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.12632271 g/mol |
| Topological Polar Surface Area (TPSA) | 105.00 Ų |
| XlogP | -1.00 |
| There are no found synonyms. |
![2D Structure of (2S,3R,4R,5R,6S)-2-[2-(aminomethyl)phenoxy]-6-methyloxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/2s3r4r5r6s-2-2-aminomethylphenoxy-6-methyloxane-345-triol.jpg "2D Structure of (2S,3R,4R,5R,6S)-2-[2-(aminomethyl)phenoxy]-6-methyloxane-3,4,5-triol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.81% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.88% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.31% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.40% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.25% | 98.95% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 86.68% | 89.62% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 84.82% | 95.93% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 83.57% | 90.24% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.14% | 97.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.77% | 99.17% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.45% | 94.73% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 81.24% | 97.36% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.43% | 96.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.00% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Reseda odorata |
| PubChem | 162860040 |
| LOTUS | LTS0101071 |
| wikiData | Q104918596 |