[(2S,3R)-5-acetyl-6-hydroxy-2-prop-1-en-2-yl-2,3-dihydro-1-benzofuran-3-yl] 3-methylbutanoate
| Internal ID | 6987a49d-dfeb-4de1-aa75-de9f4d84c2cc |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Acetophenones |
| IUPAC Name | [(2S,3R)-5-acetyl-6-hydroxy-2-prop-1-en-2-yl-2,3-dihydro-1-benzofuran-3-yl] 3-methylbutanoate |
| SMILES (Canonical) | CC(C)CC(=O)OC1C(OC2=CC(=C(C=C12)C(=O)C)O)C(=C)C |
| SMILES (Isomeric) | CC(C)CC(=O)O[C@H]1[C@@H](OC2=CC(=C(C=C12)C(=O)C)O)C(=C)C |
| InChI | InChI=1S/C18H22O5/c1-9(2)6-16(21)23-18-13-7-12(11(5)19)14(20)8-15(13)22-17(18)10(3)4/h7-9,17-18,20H,3,6H2,1-2,4-5H3/t17-,18+/m0/s1 |
| InChI Key | BOJDQFPKZMFDKY-ZWKOTPCHSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H22O5 |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.14672380 g/mol |
| Topological Polar Surface Area (TPSA) | 72.80 Ų |
| XlogP | 3.80 |
| There are no found synonyms. |
![2D Structure of [(2S,3R)-5-acetyl-6-hydroxy-2-prop-1-en-2-yl-2,3-dihydro-1-benzofuran-3-yl] 3-methylbutanoate](https://plantaedb.com/storage/docs/compounds/2023/11/2s3r-5-acetyl-6-hydroxy-2-prop-1-en-2-yl-23-dihydro-1-benzofuran-3-yl-3-methylbutanoate.jpg "2D Structure of [(2S,3R)-5-acetyl-6-hydroxy-2-prop-1-en-2-yl-2,3-dihydro-1-benzofuran-3-yl] 3-methylbutanoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.37% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.12% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.34% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 91.22% | 94.73% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.65% | 85.14% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.92% | 99.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.94% | 94.45% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.90% | 91.19% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 85.13% | 97.21% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.03% | 99.15% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.20% | 91.07% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 82.14% | 89.50% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.62% | 95.89% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.96% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Encelia canescens |
| PubChem | 163065971 |
| LOTUS | LTS0089749 |
| wikiData | Q104939255 |