(2S,3R)-2-non-8-enyl-3-[[(2S,3R)-3-pentyloxiran-2-yl]methyl]oxirane
| Internal ID | 8c056103-69c5-428a-a4a9-116c3b2c2f87 |
| Taxonomy | Organoheterocyclic compounds > Epoxides |
| IUPAC Name | (2S,3R)-2-non-8-enyl-3-[[(2S,3R)-3-pentyloxiran-2-yl]methyl]oxirane |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C19H34O2/c1-3-5-7-8-9-10-12-14-17-19(21-17)15-18-16(20-18)13-11-6-4-2/h3,16-19H,1,4-15H2,2H3/t16-,17+,18+,19-/m1/s1 |
| InChI Key | FTZXJBAYTPNIQD-YDZRNGNQSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H34O2 |
| Molecular Weight | 294.50 g/mol |
| Exact Mass | 294.255880323 g/mol |
| Topological Polar Surface Area (TPSA) | 25.10 Ų |
| XlogP | 6.40 |
| There are no found synonyms. |
![2D Structure of (2S,3R)-2-non-8-enyl-3-[[(2S,3R)-3-pentyloxiran-2-yl]methyl]oxirane](https://plantaedb.com/storage/docs/compounds/2023/11/2s3r-2-non-8-enyl-3-2s3r-3-pentyloxiran-2-ylmethyloxirane.jpg "2D Structure of (2S,3R)-2-non-8-enyl-3-[[(2S,3R)-3-pentyloxiran-2-yl]methyl]oxirane")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 94.10% | 92.08% |
| CHEMBL240 | Q12809 | HERG | 90.17% | 89.76% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.15% | 99.17% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 89.07% | 97.79% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 88.66% | 89.63% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 88.39% | 97.29% |
| CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 88.03% | 92.38% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.47% | 98.95% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 87.36% | 92.86% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.06% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.06% | 96.09% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 87.00% | 91.81% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.70% | 94.73% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 86.43% | 89.34% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.05% | 90.17% |
| CHEMBL5979 | P05186 | Alkaline phosphatase, tissue-nonspecific isozyme | 84.19% | 85.40% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 82.39% | 90.24% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.11% | 91.11% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 81.69% | 98.03% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.62% | 96.95% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.89% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 23428201 |
| LOTUS | LTS0072208 |
| wikiData | Q105001511 |