(2S)-eriodictyol 7-O-(6''-O-galloyl)-beta-D-glucopyranoside
Internal ID | 2aeefda0-f12c-4fc3-a17a-3affeacbf1c9 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | [(2R,3S,4S,5R,6S)-6-[[(2S)-2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxo-2,3-dihydrochromen-7-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl 3,4,5-trihydroxybenzoate |
SMILES (Canonical) | C1C(OC2=CC(=CC(=C2C1=O)O)OC3C(C(C(C(O3)COC(=O)C4=CC(=C(C(=C4)O)O)O)O)O)O)C5=CC(=C(C=C5)O)O |
SMILES (Isomeric) | C1[C@H](OC2=CC(=CC(=C2C1=O)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)COC(=O)C4=CC(=C(C(=C4)O)O)O)O)O)O)C5=CC(=C(C=C5)O)O |
InChI | InChI=1S/C28H26O15/c29-13-2-1-10(3-14(13)30)19-8-16(32)22-15(31)6-12(7-20(22)42-19)41-28-26(38)25(37)24(36)21(43-28)9-40-27(39)11-4-17(33)23(35)18(34)5-11/h1-7,19,21,24-26,28-31,33-38H,8-9H2/t19-,21+,24+,25-,26+,28+/m0/s1 |
InChI Key | SHPCBRSOJXQRDY-RKLFNRSMSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H26O15 |
Molecular Weight | 602.50 g/mol |
Exact Mass | 602.12717012 g/mol |
Topological Polar Surface Area (TPSA) | 253.00 Ų |
XlogP | 0.80 |
CHEBI:85145 |
Q27158357 |
(2S)-3',4',5-Trihydroxy-7-(6-O-galloyl-beta-D-glucopyranosyloxy)flavanone |
[(2R,3S,4S,5R,6S)-6-[[(2S)-2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxo-2,3-dihydrochromen-7-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl 3,4,5-trihydroxybenzoate |
2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxo-4H-chromen-7-yl 6-O-(3,4,5-trihydroxybenzoyl)-beta-D-glucopyranoside |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.77% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.45% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.42% | 96.09% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 93.71% | 83.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 91.49% | 90.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.37% | 89.00% |
CHEMBL3194 | P02766 | Transthyretin | 90.73% | 90.71% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 90.28% | 95.64% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.25% | 99.15% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.07% | 94.45% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.84% | 95.89% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 89.49% | 91.49% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.31% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.88% | 94.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.50% | 99.17% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 87.97% | 94.80% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.67% | 99.23% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 87.09% | 92.50% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.98% | 90.71% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.69% | 94.73% |
CHEMBL2581 | P07339 | Cathepsin D | 85.01% | 98.95% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 84.50% | 95.78% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 81.42% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Balanophora harlandii |
Phyllanthus emblica |
PubChem | 10930068 |
NPASS | NPC112389 |
LOTUS | LTS0154846 |
wikiData | Q27158357 |