(2S)-8-(2,4-dihydroxyphenyl)-4-hydroxy-2-prop-1-en-2-yl-2,3-dihydrofuro[2,3-f]chromen-9-one
| Internal ID | 70acbef3-e799-4995-8e8b-f4458c3dc275 |
| Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflavans > Isoflavanones > 6-prenylated isoflavanones |
| IUPAC Name | (2S)-8-(2,4-dihydroxyphenyl)-4-hydroxy-2-prop-1-en-2-yl-2,3-dihydrofuro[2,3-f]chromen-9-one |
| SMILES (Canonical) | CC(=C)C1CC2=C(O1)C3=C(C=C2O)OC=C(C3=O)C4=C(C=C(C=C4)O)O |
| SMILES (Isomeric) | CC(=C)[C@@H]1CC2=C(O1)C3=C(C=C2O)OC=C(C3=O)C4=C(C=C(C=C4)O)O |
| InChI | InChI=1S/C20H16O6/c1-9(2)16-6-12-15(23)7-17-18(20(12)26-16)19(24)13(8-25-17)11-4-3-10(21)5-14(11)22/h3-5,7-8,16,21-23H,1,6H2,2H3/t16-/m0/s1 |
| InChI Key | HHQAAUSMOBNXFL-INIZCTEOSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H16O6 |
| Molecular Weight | 352.30 g/mol |
| Exact Mass | 352.09468823 g/mol |
| Topological Polar Surface Area (TPSA) | 96.20 Ų |
| XlogP | 3.40 |
| There are no found synonyms. |
![2D Structure of (2S)-8-(2,4-dihydroxyphenyl)-4-hydroxy-2-prop-1-en-2-yl-2,3-dihydrofuro[2,3-f]chromen-9-one](https://plantaedb.com/storage/docs/compounds/2023/11/2s-8-24-dihydroxyphenyl-4-hydroxy-2-prop-1-en-2-yl-23-dihydrofuro23-fchromen-9-one.jpg "2D Structure of (2S)-8-(2,4-dihydroxyphenyl)-4-hydroxy-2-prop-1-en-2-yl-2,3-dihydrofuro[2,3-f]chromen-9-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.39% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.67% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.01% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.33% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.00% | 86.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.51% | 99.23% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 86.41% | 91.49% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.54% | 98.75% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.38% | 90.00% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 82.41% | 90.93% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.14% | 96.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.42% | 95.89% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 80.42% | 85.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.11% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Crotalaria lachnophora |
| PubChem | 162924518 |
| LOTUS | LTS0146814 |
| wikiData | Q105028462 |