7-Methyl-2-propan-2-yluro[3,2-h]isoquinolin-3-one
| Internal ID | 54c75585-eb8b-43eb-a5b1-9d53f0b97ec3 |
| Taxonomy | Organoheterocyclic compounds > Isoquinolines and derivatives |
| IUPAC Name | (2S)-7-methyl-2-propan-2-ylfuro[3,2-h]isoquinolin-3-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H15NO2/c1-8(2)14-13(17)11-5-4-10-6-9(3)16-7-12(10)15(11)18-14/h4-8,14H,1-3H3/t14-/m0/s1 |
| InChI Key | JROFCJKUGPMKCQ-AWEZNQCLSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.110278721 g/mol |
| Topological Polar Surface Area (TPSA) | 39.20 Ų |
| XlogP | 3.40 |
| 7-methyl-2-propan-2-yluro[3,2-h]isoquinolin-3-one |
![2D Structure of 7-Methyl-2-propan-2-yluro[3,2-h]isoquinolin-3-one](https://plantaedb.com/storage/docs/compounds/2023/11/2s-7-methyl-2-propan-2-ylfuro32-hisoquinolin-3-one.jpg "2D Structure of 7-Methyl-2-propan-2-yluro[3,2-h]isoquinolin-3-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 98.90% | 91.49% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 92.44% | 94.73% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 91.05% | 93.65% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 89.88% | 94.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.49% | 95.56% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.96% | 90.71% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.87% | 98.75% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 87.61% | 93.31% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.98% | 99.23% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.76% | 94.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.03% | 89.00% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 85.91% | 93.10% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.81% | 98.95% |
| CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 82.59% | 92.50% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 82.57% | 93.40% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.34% | 93.56% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.41% | 100.00% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 80.10% | 88.42% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 80.03% | 83.10% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 15871768 |
| LOTUS | LTS0093554 |
| wikiData | Q105134010 |