(2S)-6-amino-2-(hydroxyamino)hexanoic acid
| Internal ID | 5cecd6bc-6e47-4aee-9d8d-79b3fa91d47c |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives > N-hydroxyl-alpha-amino acids |
| IUPAC Name | (2S)-6-amino-2-(hydroxyamino)hexanoic acid |
| SMILES (Canonical) | C(CCN)CC(C(=O)O)NO |
| SMILES (Isomeric) | C(CCN)C[C@@H](C(=O)O)NO |
| InChI | InChI=1S/C6H14N2O3/c7-4-2-1-3-5(8-11)6(9)10/h5,8,11H,1-4,7H2,(H,9,10)/t5-/m0/s1 |
| InChI Key | QJHBJHUKURJDLG-YFKPBYRVSA-N |
| Popularity | 172 references in papers |
| Molecular Formula | C6H14N2O3 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.10044231 g/mol |
| Topological Polar Surface Area (TPSA) | 95.60 Ų |
| XlogP | -3.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.84% | 99.17% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.85% | 90.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.42% | 96.09% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 86.81% | 90.20% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 86.20% | 100.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.60% | 96.00% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 85.25% | 97.21% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 85.24% | 97.29% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 85.20% | 100.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.09% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 83.17% | 98.95% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.24% | 96.95% |
| CHEMBL2973 | O75116 | Rho-associated protein kinase 2 | 81.63% | 96.73% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 81.23% | 92.29% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 81.18% | 82.86% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.44% | 95.50% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.00% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Medicago sativa |
| PubChem | 18394836 |
| LOTUS | LTS0187653 |
| wikiData | Q105222670 |