(2S)-5,7-dihydroxy-2-(2-hydroxy-4,6-dimethoxyphenyl)-2,3-dihydrochromen-4-one
Internal ID | 1dd37404-8da7-427c-8343-f3bac042073a |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 4-O-methylated flavonoids |
IUPAC Name | (2S)-5,7-dihydroxy-2-(2-hydroxy-4,6-dimethoxyphenyl)-2,3-dihydrochromen-4-one |
SMILES (Canonical) | COC1=CC(=C(C(=C1)OC)C2CC(=O)C3=C(C=C(C=C3O2)O)O)O |
SMILES (Isomeric) | COC1=CC(=C(C(=C1)OC)[C@@H]2CC(=O)C3=C(C=C(C=C3O2)O)O)O |
InChI | InChI=1S/C17H16O7/c1-22-9-5-11(20)17(13(6-9)23-2)15-7-12(21)16-10(19)3-8(18)4-14(16)24-15/h3-6,15,18-20H,7H2,1-2H3/t15-/m0/s1 |
InChI Key | NCPYLTRCYLEFPL-HNNXBMFYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C17H16O7 |
Molecular Weight | 332.30 g/mol |
Exact Mass | 332.08960285 g/mol |
Topological Polar Surface Area (TPSA) | 105.00 Ų |
XlogP | 2.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.13% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.28% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.55% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 92.82% | 90.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.12% | 94.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.97% | 99.15% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.90% | 99.23% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 89.80% | 83.82% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.32% | 94.45% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.82% | 92.94% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 86.69% | 96.12% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.18% | 92.62% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.18% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.13% | 89.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.53% | 99.17% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 85.48% | 92.68% |
CHEMBL2581 | P07339 | Cathepsin D | 84.92% | 98.95% |
CHEMBL2535 | P11166 | Glucose transporter | 84.61% | 98.75% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.42% | 91.07% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.07% | 97.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.37% | 86.33% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 82.53% | 91.79% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.40% | 85.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.23% | 97.09% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.65% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Artocarpus altilis |
PubChem | 102180343 |
LOTUS | LTS0254409 |
wikiData | Q105177320 |