(2S)-5,6-dihydroxy-8-methoxy-2-methyl-7,9-bis(3-methylbut-2-enyl)-2,3-dihydrobenzo[g]chromen-4-one
| Internal ID | 7fe90181-e9ce-405a-9064-d18371dff3fe |
| Taxonomy | Organoheterocyclic compounds > Naphthopyrans > Naphthopyranones |
| IUPAC Name | (2S)-5,6-dihydroxy-8-methoxy-2-methyl-7,9-bis(3-methylbut-2-enyl)-2,3-dihydrobenzo[g]chromen-4-one |
| SMILES (Canonical) | CC1CC(=O)C2=C(O1)C=C3C(=C(C(=C(C3=C2O)O)CC=C(C)C)OC)CC=C(C)C |
| SMILES (Isomeric) | C[C@H]1CC(=O)C2=C(O1)C=C3C(=C(C(=C(C3=C2O)O)CC=C(C)C)OC)CC=C(C)C |
| InChI | InChI=1S/C25H30O5/c1-13(2)7-9-16-18-12-20-22(19(26)11-15(5)30-20)24(28)21(18)23(27)17(25(16)29-6)10-8-14(3)4/h7-8,12,15,27-28H,9-11H2,1-6H3/t15-/m0/s1 |
| InChI Key | BUMMMTPWVQOQSF-HNNXBMFYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C25H30O5 |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.20932405 g/mol |
| Topological Polar Surface Area (TPSA) | 76.00 Ų |
| XlogP | 6.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.79% | 91.11% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 96.69% | 92.68% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.56% | 94.45% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.65% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.25% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.78% | 89.00% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 90.66% | 94.80% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.02% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.03% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.62% | 96.09% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.71% | 94.73% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 87.65% | 89.34% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.89% | 99.17% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.27% | 99.23% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.00% | 92.62% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.91% | 94.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.61% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Adenaria floribunda |
| PubChem | 162981769 |
| LOTUS | LTS0083073 |
| wikiData | Q104946175 |