(2s)-5,2'-Dihydroxy-7,5'-dimethoxyflavanone
| Internal ID | 99842c04-f456-4adb-bd8c-a920a3963094 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 7-O-methylated flavonoids |
| IUPAC Name | (2S)-5-hydroxy-2-(2-hydroxy-5-methoxyphenyl)-7-methoxy-2,3-dihydrochromen-4-one |
| SMILES (Canonical) | COC1=CC(=C(C=C1)O)C2CC(=O)C3=C(C=C(C=C3O2)OC)O |
| SMILES (Isomeric) | COC1=CC(=C(C=C1)O)[C@@H]2CC(=O)C3=C(C=C(C=C3O2)OC)O |
| InChI | InChI=1S/C17H16O6/c1-21-9-3-4-12(18)11(5-9)15-8-14(20)17-13(19)6-10(22-2)7-16(17)23-15/h3-7,15,18-19H,8H2,1-2H3/t15-/m0/s1 |
| InChI Key | XMFCMXPYIULHFX-HNNXBMFYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C17H16O6 |
| Molecular Weight | 316.30 g/mol |
| Exact Mass | 316.09468823 g/mol |
| Topological Polar Surface Area (TPSA) | 85.20 Ų |
| XlogP | 2.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.18% | 91.11% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 96.27% | 99.15% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.07% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.83% | 96.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 91.57% | 90.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.16% | 94.45% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.62% | 99.23% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.06% | 85.14% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.53% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.38% | 98.95% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.85% | 95.89% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 87.55% | 91.07% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.23% | 97.09% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.85% | 94.00% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 85.81% | 96.12% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 83.68% | 94.80% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.60% | 92.62% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.08% | 89.00% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 82.37% | 91.79% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 80.81% | 93.40% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Onosma hispida |
| PubChem | 91600795 |
| LOTUS | LTS0186131 |
| wikiData | Q105330687 |