(2S)-2-(4-hydroxyphenyl)-5,7-dimethoxy-2,3-dihydrochromen-4-one
Internal ID | 9f2cb659-6b8b-4442-9c6e-66e9ffdbe822 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 7-O-methylated flavonoids |
IUPAC Name | (2S)-2-(4-hydroxyphenyl)-5,7-dimethoxy-2,3-dihydrochromen-4-one |
SMILES (Canonical) | COC1=CC2=C(C(=O)CC(O2)C3=CC=C(C=C3)O)C(=C1)OC |
SMILES (Isomeric) | COC1=CC2=C(C(=O)C[C@H](O2)C3=CC=C(C=C3)O)C(=C1)OC |
InChI | InChI=1S/C17H16O5/c1-20-12-7-15(21-2)17-13(19)9-14(22-16(17)8-12)10-3-5-11(18)6-4-10/h3-8,14,18H,9H2,1-2H3/t14-/m0/s1 |
InChI Key | REBBZOCNEVVAPX-AWEZNQCLSA-N |
Popularity | 0 references in papers |
Molecular Formula | C17H16O5 |
Molecular Weight | 300.30 g/mol |
Exact Mass | 300.09977361 g/mol |
Topological Polar Surface Area (TPSA) | 65.00 Ų |
XlogP | 2.50 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.97% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.56% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.70% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.25% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.48% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.77% | 94.45% |
CHEMBL4208 | P20618 | Proteasome component C5 | 90.62% | 90.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.90% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 88.34% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.28% | 86.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.80% | 99.23% |
CHEMBL2535 | P11166 | Glucose transporter | 87.15% | 98.75% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.28% | 99.15% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.06% | 89.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.79% | 95.89% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.40% | 99.17% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 80.27% | 88.48% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.06% | 95.89% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.04% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Abies nephrolepis |
Viscum album |
PubChem | 40484437 |
LOTUS | LTS0079445 |
wikiData | Q104888878 |