(2S)-2-(2,2-dimethylchromen-6-yl)-7-hydroxy-8-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one
Internal ID | fbbc519b-4026-4bd3-973f-38da570e323c |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > 8-prenylated flavans > 8-prenylated flavanones |
IUPAC Name | (2S)-2-(2,2-dimethylchromen-6-yl)-7-hydroxy-8-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one |
SMILES (Canonical) | CC(=CCC1=C(C=CC2=C1OC(CC2=O)C3=CC4=C(C=C3)OC(C=C4)(C)C)O)C |
SMILES (Isomeric) | CC(=CCC1=C(C=CC2=C1O[C@@H](CC2=O)C3=CC4=C(C=C3)OC(C=C4)(C)C)O)C |
InChI | InChI=1S/C25H26O4/c1-15(2)5-7-18-20(26)9-8-19-21(27)14-23(28-24(18)19)16-6-10-22-17(13-16)11-12-25(3,4)29-22/h5-6,8-13,23,26H,7,14H2,1-4H3/t23-/m0/s1 |
InChI Key | VSUQUSVBOASRIA-QHCPKHFHSA-N |
Popularity | 4 references in papers |
Molecular Formula | C25H26O4 |
Molecular Weight | 390.50 g/mol |
Exact Mass | 390.18310931 g/mol |
Topological Polar Surface Area (TPSA) | 55.80 Ų |
XlogP | 5.40 |
BDBM50267183 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.71% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.68% | 91.49% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.99% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 97.10% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.83% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.41% | 89.00% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 92.23% | 93.40% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.73% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.28% | 94.45% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.87% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.29% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.52% | 90.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.78% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.84% | 95.89% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.77% | 94.73% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.08% | 90.17% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 82.01% | 95.71% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.42% | 96.95% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.00% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Euchresta formosana |
Glycyrrhiza glabra |
PubChem | 73355595 |
LOTUS | LTS0183508 |
wikiData | Q105292550 |