(2S)-2-[(1R,2E)-11,11-dibromo-1-methoxyundeca-2,10-dienyl]oxolane
| Internal ID | e514a872-c370-4649-85a9-8292dcadca8a |
| Taxonomy | Organoheterocyclic compounds > Tetrahydrofurans |
| IUPAC Name | (2S)-2-[(1R,2E)-11,11-dibromo-1-methoxyundeca-2,10-dienyl]oxolane |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C16H26Br2O2/c1-19-14(15-11-9-13-20-15)10-7-5-3-2-4-6-8-12-16(17)18/h7,10,12,14-15H,2-6,8-9,11,13H2,1H3/b10-7+/t14-,15+/m1/s1 |
| InChI Key | PEUQTGHGULKWLT-AEOIHIIDSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C16H26Br2O2 |
| Molecular Weight | 410.20 g/mol |
| Exact Mass | 410.02791 g/mol |
| Topological Polar Surface Area (TPSA) | 18.50 Ų |
| XlogP | 5.80 |
| There are no found synonyms. |
![2D Structure of (2S)-2-[(1R,2E)-11,11-dibromo-1-methoxyundeca-2,10-dienyl]oxolane](https://plantaedb.com/storage/docs/compounds/2023/11/2s-2-1r2e-1111-dibromo-1-methoxyundeca-210-dienyloxolane.jpg "2D Structure of (2S)-2-[(1R,2E)-11,11-dibromo-1-methoxyundeca-2,10-dienyl]oxolane")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.95% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.63% | 96.09% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 93.18% | 95.17% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.72% | 97.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.66% | 99.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.67% | 94.45% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 88.55% | 92.88% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 88.44% | 90.08% |
| CHEMBL3975 | P09467 | Fructose-1,6-bisphosphatase | 88.34% | 92.95% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 86.92% | 95.58% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 86.59% | 99.18% |
| CHEMBL2581 | P07339 | Cathepsin D | 85.29% | 98.95% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 84.76% | 97.47% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.14% | 100.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.63% | 93.56% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.44% | 95.50% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 82.12% | 91.03% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 82.01% | 97.50% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.96% | 100.00% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.41% | 93.00% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.09% | 94.33% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.98% | 95.89% |
| CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 80.75% | 95.36% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162959172 |
| LOTUS | LTS0064865 |
| wikiData | Q105207368 |