(2R,9S,11R,12R,14R,16S)-14-methyl-1,4-diazapentacyclo[7.7.1.02,12.03,8.011,16]heptadec-3(8)-en-5-one
| Internal ID | f72b4b0b-fcd8-47ce-a5ff-626d283d43cd |
| Taxonomy | Organoheterocyclic compounds > Quinolidines |
| IUPAC Name | (2R,9S,11R,12R,14R,16S)-14-methyl-1,4-diazapentacyclo[7.7.1.02,12.03,8.011,16]heptadec-3(8)-en-5-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C16H22N2O/c1-8-4-12-11-6-9-7-18(13(11)5-8)16(12)15-10(9)2-3-14(19)17-15/h8-9,11-13,16H,2-7H2,1H3,(H,17,19)/t8-,9-,11-,12-,13+,16-/m1/s1 |
| InChI Key | AFNXZZYYOWKUAH-JJAUGWOVSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.173213330 g/mol |
| Topological Polar Surface Area (TPSA) | 32.30 Ų |
| XlogP | 1.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.39% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.44% | 97.25% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 90.99% | 93.40% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.62% | 97.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.77% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.65% | 95.56% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 85.32% | 82.69% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 84.41% | 94.78% |
| CHEMBL3045 | P05771 | Protein kinase C beta | 83.60% | 97.63% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 83.51% | 97.05% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 83.13% | 94.66% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.03% | 100.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.88% | 94.75% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.11% | 99.23% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 80.25% | 85.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Erythrina mildbraedii |
| PubChem | 16043296 |
| LOTUS | LTS0131502 |
| wikiData | Q105259066 |