(2R,9R,13bS)-2,9,11,12-tetramethoxy-1,2,8,9-tetrahydroindolo[7a,1-a]isoquinolin-6-one
| Internal ID | 234c7eb6-3fbe-470f-9313-def562231d47 |
| Taxonomy | Alkaloids and derivatives > Erythrina alkaloids > Erythrinanes |
| IUPAC Name | (2R,9R,13bS)-2,9,11,12-tetramethoxy-1,2,8,9-tetrahydroindolo[7a,1-a]isoquinolin-6-one |
| SMILES (Canonical) | COC1CC23C(=CC(=O)N2CC(C4=CC(=C(C=C34)OC)OC)OC)C=C1 |
| SMILES (Isomeric) | CO[C@@H]1C[C@@]23C(=CC(=O)N2C[C@@H](C4=CC(=C(C=C34)OC)OC)OC)C=C1 |
| InChI | InChI=1S/C20H23NO5/c1-23-13-6-5-12-7-19(22)21-11-18(26-4)14-8-16(24-2)17(25-3)9-15(14)20(12,21)10-13/h5-9,13,18H,10-11H2,1-4H3/t13-,18-,20-/m0/s1 |
| InChI Key | GGVTWFRUJRJVGT-GMVOTWDCSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.15762283 g/mol |
| Topological Polar Surface Area (TPSA) | 57.20 Ų |
| XlogP | 0.90 |
| There are no found synonyms. |
![2D Structure of (2R,9R,13bS)-2,9,11,12-tetramethoxy-1,2,8,9-tetrahydroindolo[7a,1-a]isoquinolin-6-one](https://plantaedb.com/storage/docs/compounds/2023/11/2r9r13bs-291112-tetramethoxy-1289-tetrahydroindolo7a1-aisoquinolin-6-one.jpg "2D Structure of (2R,9R,13bS)-2,9,11,12-tetramethoxy-1,2,8,9-tetrahydroindolo[7a,1-a]isoquinolin-6-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.32% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.09% | 96.09% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 90.45% | 92.94% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.36% | 97.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.06% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.17% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.16% | 86.33% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 85.93% | 82.69% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 83.78% | 94.78% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.18% | 94.00% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 82.28% | 82.38% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.05% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.76% | 97.09% |
| CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 80.72% | 92.38% |
| CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 80.49% | 95.53% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 80.11% | 90.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Erythrina lysistemon |
| PubChem | 11394212 |
| LOTUS | LTS0055927 |
| wikiData | Q105008336 |