(2R,5S)-2-methyl-2-[(1S)-4-methylcyclohex-3-en-1-yl]-5-prop-1-en-2-yloxolane
| Internal ID | ab081dbf-2ec0-44c2-8bfa-cd5de4afdc89 |
| Taxonomy | Organoheterocyclic compounds > Tetrahydrofurans |
| IUPAC Name | (2R,5S)-2-methyl-2-[(1S)-4-methylcyclohex-3-en-1-yl]-5-prop-1-en-2-yloxolane |
| SMILES (Canonical) | CC1=CCC(CC1)C2(CCC(O2)C(=C)C)C |
| SMILES (Isomeric) | CC1=CC[C@H](CC1)[C@]2(CC[C@H](O2)C(=C)C)C |
| InChI | InChI=1S/C15H24O/c1-11(2)14-9-10-15(4,16-14)13-7-5-12(3)6-8-13/h5,13-14H,1,6-10H2,2-4H3/t13-,14+,15-/m1/s1 |
| InChI Key | AKAQULCXJUDSBA-QLFBSQMISA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.35 g/mol |
| Exact Mass | 220.182715385 g/mol |
| Topological Polar Surface Area (TPSA) | 9.20 Ų |
| XlogP | 3.80 |
| There are no found synonyms. |
![2D Structure of (2R,5S)-2-methyl-2-[(1S)-4-methylcyclohex-3-en-1-yl]-5-prop-1-en-2-yloxolane](https://plantaedb.com/storage/docs/compounds/2023/11/2r5s-2-methyl-2-1s-4-methylcyclohex-3-en-1-yl-5-prop-1-en-2-yloxolane.jpg "2D Structure of (2R,5S)-2-methyl-2-[(1S)-4-methylcyclohex-3-en-1-yl]-5-prop-1-en-2-yloxolane")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.84% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.46% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.08% | 97.25% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.57% | 100.00% |
| CHEMBL1871 | P10275 | Androgen Receptor | 84.85% | 96.43% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 83.35% | 96.61% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.34% | 92.94% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 81.56% | 95.38% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.82% | 95.89% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.06% | 89.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.01% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Coreopsis grandiflora |
| PubChem | 163046295 |
| LOTUS | LTS0106687 |
| wikiData | Q104913502 |