(2R,3Z)-2-aminohexa-3,5-dienoic acid
| Internal ID | 490befec-e934-4bf9-9dbc-dfcca14469fd |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives > Alpha amino acids > D-alpha-amino acids |
| IUPAC Name | (2R,3Z)-2-aminohexa-3,5-dienoic acid |
| SMILES (Canonical) | C=CC=CC(C(=O)O)N |
| SMILES (Isomeric) | C=C/C=C\[C@H](C(=O)O)N |
| InChI | InChI=1S/C6H9NO2/c1-2-3-4-5(7)6(8)9/h2-5H,1,7H2,(H,8,9)/b4-3-/t5-/m1/s1 |
| InChI Key | LAVTULVXLBWEBX-CLBPYYFESA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.063328530 g/mol |
| Topological Polar Surface Area (TPSA) | 63.30 Ų |
| XlogP | -1.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4246 | P42680 | Tyrosine-protein kinase TEC | 90.48% | 82.05% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.06% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.94% | 94.45% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.88% | 99.17% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.05% | 91.19% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.79% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 101935694 |
| LOTUS | LTS0134217 |
| wikiData | Q105149004 |