(2R,3S,6S)-3-ethenyl-6-propan-2-yl-2-prop-1-en-2-ylcyclohexan-1-one
| Internal ID | c7de3d50-5195-4fe0-83fd-92e213027233 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Monoterpenoids > Menthane monoterpenoids |
| IUPAC Name | (2R,3S,6S)-3-ethenyl-6-propan-2-yl-2-prop-1-en-2-ylcyclohexan-1-one |
| SMILES (Canonical) | CC(C)C1CCC(C(C1=O)C(=C)C)C=C |
| SMILES (Isomeric) | CC(C)[C@@H]1CC[C@H]([C@@H](C1=O)C(=C)C)C=C |
| InChI | InChI=1S/C14H22O/c1-6-11-7-8-12(9(2)3)14(15)13(11)10(4)5/h6,9,11-13H,1,4,7-8H2,2-3,5H3/t11-,12+,13+/m1/s1 |
| InChI Key | QGRQKLHZONWMTM-AGIUHOORSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.32 g/mol |
| Exact Mass | 206.167065321 g/mol |
| Topological Polar Surface Area (TPSA) | 17.10 Ų |
| XlogP | 4.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 92.95% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.75% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.15% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.65% | 96.09% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.09% | 94.75% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.41% | 91.19% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.54% | 95.56% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 84.29% | 89.34% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.47% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.71% | 95.89% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 82.12% | 96.47% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.76% | 85.14% |
| CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 81.65% | 92.78% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.24% | 90.71% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 81.23% | 90.08% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.15% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Acorus calamus |
| PubChem | 163067097 |
| LOTUS | LTS0147891 |
| wikiData | Q105220592 |