[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(2-methylpropanoyloxy)oxan-2-yl]methyl (E)-2-methylbut-2-enoate
| Internal ID | a0f167ec-1160-4008-821e-7718e02fad1f |
| Taxonomy | Lipids and lipid-like molecules > Saccharolipids |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(2-methylpropanoyloxy)oxan-2-yl]methyl (E)-2-methylbut-2-enoate |
| SMILES (Canonical) | CC=C(C)C(=O)OCC1C(C(C(C(O1)OC(=O)C(C)C)O)O)O |
| SMILES (Isomeric) | C/C=C(\C)/C(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)OC(=O)C(C)C)O)O)O |
| InChI | InChI=1S/C15H24O8/c1-5-8(4)14(20)21-6-9-10(16)11(17)12(18)15(22-9)23-13(19)7(2)3/h5,7,9-12,15-18H,6H2,1-4H3/b8-5+/t9-,10-,11+,12-,15+/m1/s1 |
| InChI Key | QENJDTJCMGUSOF-QIJGCHGOSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H24O8 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.14711772 g/mol |
| Topological Polar Surface Area (TPSA) | 123.00 Ų |
| XlogP | 0.20 |
| There are no found synonyms. |
![2D Structure of [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(2-methylpropanoyloxy)oxan-2-yl]methyl (E)-2-methylbut-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/2r3s4s5r6s-345-trihydroxy-6-2-methylpropanoyloxyoxan-2-ylmethyl-e-2-methylbut-2-enoate.jpg "2D Structure of [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(2-methylpropanoyloxy)oxan-2-yl]methyl (E)-2-methylbut-2-enoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.02% | 96.09% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 93.67% | 96.47% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.57% | 91.11% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.37% | 94.73% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.27% | 97.25% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.69% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.16% | 99.17% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 84.95% | 89.34% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 84.41% | 95.93% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 84.34% | 98.75% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.23% | 89.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.03% | 96.00% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 81.75% | 82.50% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.73% | 96.95% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.91% | 94.33% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.89% | 97.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Picradeniopsis schaffneri |
| PubChem | 162971345 |
| LOTUS | LTS0169556 |
| wikiData | Q105219308 |