[(2R,3S,4S,5R,6R)-6-[(R)-cyano(phenyl)methoxy]-3,4,5-trihydroxyoxan-2-yl]methyl (E)-but-2-enoate
| Internal ID | 63ce7975-af1b-4df6-8f04-c92c783526c0 |
| Taxonomy | Lipids and lipid-like molecules > Saccharolipids |
| IUPAC Name | [(2R,3S,4S,5R,6R)-6-[(R)-cyano(phenyl)methoxy]-3,4,5-trihydroxyoxan-2-yl]methyl (E)-but-2-enoate |
| SMILES (Canonical) | CC=CC(=O)OCC1C(C(C(C(O1)OC(C#N)C2=CC=CC=C2)O)O)O |
| SMILES (Isomeric) | C/C=C/C(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O[C@@H](C#N)C2=CC=CC=C2)O)O)O |
| InChI | InChI=1S/C18H21NO7/c1-2-6-14(20)24-10-13-15(21)16(22)17(23)18(26-13)25-12(9-19)11-7-4-3-5-8-11/h2-8,12-13,15-18,21-23H,10H2,1H3/b6-2+/t12-,13+,15+,16-,17+,18+/m0/s1 |
| InChI Key | LPZZSIWYPLGRQU-ZVKWVLOSSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H21NO7 |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.13180201 g/mol |
| Topological Polar Surface Area (TPSA) | 129.00 Ų |
| XlogP | 0.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 97.14% | 90.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.40% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.20% | 91.11% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 93.68% | 94.73% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.26% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.20% | 86.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.10% | 96.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.60% | 95.56% |
| CHEMBL5028 | O14672 | ADAM10 | 86.03% | 97.50% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.84% | 95.50% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.56% | 99.17% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 84.20% | 83.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.14% | 98.75% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 82.19% | 94.08% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.10% | 93.56% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 81.25% | 94.62% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 80.76% | 94.80% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.67% | 89.00% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 80.31% | 95.93% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Centaurea aspera |
| PubChem | 101634631 |
| LOTUS | LTS0072020 |
| wikiData | Q105155451 |