[(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl (E)-3-(4-methoxyphenyl)prop-2-enoate
Internal ID | 51194390-92c9-48b3-9d37-e98b80aed2dc |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Cinnamic acid esters |
IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl (E)-3-(4-methoxyphenyl)prop-2-enoate |
SMILES (Canonical) | COC1=CC=C(C=C1)C=CC(=O)OCC2C(C(C(C(O2)O)O)O)O |
SMILES (Isomeric) | COC1=CC=C(C=C1)/C=C/C(=O)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)O)O)O)O |
InChI | InChI=1S/C16H20O8/c1-22-10-5-2-9(3-6-10)4-7-12(17)23-8-11-13(18)14(19)15(20)16(21)24-11/h2-7,11,13-16,18-21H,8H2,1H3/b7-4+/t11-,13-,14+,15-,16-/m1/s1 |
InChI Key | MTOYMHLXRWCTMD-ORXIWHNOSA-N |
Popularity | 0 references in papers |
Molecular Formula | C16H20O8 |
Molecular Weight | 340.32 g/mol |
Exact Mass | 340.11581759 g/mol |
Topological Polar Surface Area (TPSA) | 126.00 Ų |
XlogP | -0.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.47% | 96.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.39% | 96.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.31% | 91.11% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.28% | 90.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.74% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.10% | 95.56% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 91.05% | 95.93% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.29% | 99.17% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.41% | 90.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.30% | 94.73% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.24% | 97.09% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 86.22% | 86.92% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Spiraea canescens |
PubChem | 163190056 |
LOTUS | LTS0184153 |
wikiData | Q104888774 |