[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-phenylmethoxyoxan-2-yl]methyl 3,4,5-trihydroxybenzoate
Internal ID | 63d70c8d-d50c-40d6-868a-9947989fc254 |
Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzoic acids and derivatives > Hydroxybenzoic acid derivatives > Gallic acid and derivatives > Galloyl esters |
IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-phenylmethoxyoxan-2-yl]methyl 3,4,5-trihydroxybenzoate |
SMILES (Canonical) | C1=CC=C(C=C1)COC2C(C(C(C(O2)COC(=O)C3=CC(=C(C(=C3)O)O)O)O)O)O |
SMILES (Isomeric) | C1=CC=C(C=C1)CO[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)COC(=O)C3=CC(=C(C(=C3)O)O)O)O)O)O |
InChI | InChI=1S/C20H22O10/c21-12-6-11(7-13(22)15(12)23)19(27)28-9-14-16(24)17(25)18(26)20(30-14)29-8-10-4-2-1-3-5-10/h1-7,14,16-18,20-26H,8-9H2/t14-,16-,17+,18-,20-/m1/s1 |
InChI Key | CJVSZACCCLUFJN-UVNCQSPWSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H22O10 |
Molecular Weight | 422.40 g/mol |
Exact Mass | 422.12129689 g/mol |
Topological Polar Surface Area (TPSA) | 166.00 Ų |
XlogP | -0.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.70% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.56% | 99.17% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 93.44% | 83.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.70% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 92.26% | 94.73% |
CHEMBL2581 | P07339 | Cathepsin D | 91.25% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.92% | 96.09% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 89.13% | 95.50% |
CHEMBL3891 | P07384 | Calpain 1 | 88.32% | 93.04% |
CHEMBL3194 | P02766 | Transthyretin | 85.40% | 90.71% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.98% | 94.00% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 83.76% | 95.64% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.67% | 95.89% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 82.64% | 91.49% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.39% | 95.56% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 82.00% | 85.31% |
CHEMBL2535 | P11166 | Glucose transporter | 81.15% | 98.75% |
CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 80.42% | 92.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Eucalyptus cypellocarpa |
Monochaetum multiflorum |
PubChem | 102023507 |
LOTUS | LTS0049312 |
wikiData | Q104961777 |