(2R,3S)-2-amino-3-[(2R)-2-amino-2-carboxyethyl]sulfanylbutanoic acid
| Internal ID | 0084c182-0491-4bd8-ad6c-b30fe4bfa53b |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Cysteine and derivatives |
| IUPAC Name | (2R,3S)-2-amino-3-[(2R)-2-amino-2-carboxyethyl]sulfanylbutanoic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C7H14N2O4S/c1-3(5(9)7(12)13)14-2-4(8)6(10)11/h3-5H,2,8-9H2,1H3,(H,10,11)(H,12,13)/t3-,4-,5-/m0/s1 |
| InChI Key | NSGOABPZARPCFM-YUPRTTJUSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C7H14N2O4S |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.06742811 g/mol |
| Topological Polar Surface Area (TPSA) | 152.00 Ų |
| XlogP | -5.90 |
| There are no found synonyms. |
![2D Structure of (2R,3S)-2-amino-3-[(2R)-2-amino-2-carboxyethyl]sulfanylbutanoic acid](https://plantaedb.com/storage/docs/compounds/2023/11/2r3s-2-amino-3-2r-2-amino-2-carboxyethylsulfanylbutanoic-acid.jpg "2D Structure of (2R,3S)-2-amino-3-[(2R)-2-amino-2-carboxyethyl]sulfanylbutanoic acid")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.80% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.65% | 98.95% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 88.14% | 83.82% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 86.10% | 92.29% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 83.63% | 100.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.74% | 90.17% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.68% | 99.17% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 81.44% | 95.93% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.04% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 101311681 |
| LOTUS | LTS0057736 |
| wikiData | Q105185027 |