(2R,3R,10S,12R)-2-prop-2-enyl-1,8-diazatetracyclo[8.3.1.03,8.03,12]tetradec-5-en-7-one
Internal ID | d00f6f8d-8a0b-4dad-8ff9-bbed915caee6 |
Taxonomy | Organoheterocyclic compounds > Diazepanes > 1,4-diazepanes |
IUPAC Name | (2R,3R,10S,12R)-2-prop-2-enyl-1,8-diazatetracyclo[8.3.1.03,8.03,12]tetradec-5-en-7-one |
SMILES (Canonical) | C=CCC1C23CC=CC(=O)N2CC4CC3CN1C4 |
SMILES (Isomeric) | C=CC[C@@H]1[C@]23CC=CC(=O)N2C[C@H]4C[C@@H]3CN1C4 |
InChI | InChI=1S/C15H20N2O/c1-2-4-13-15-6-3-5-14(18)17(15)9-11-7-12(15)10-16(13)8-11/h2-3,5,11-13H,1,4,6-10H2/t11-,12+,13+,15+/m0/s1 |
InChI Key | UOFWJTMKMMITRT-KYEXWDHISA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H20N2O |
Molecular Weight | 244.33 g/mol |
Exact Mass | 244.157563266 g/mol |
Topological Polar Surface Area (TPSA) | 23.60 Ų |
XlogP | 1.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 89.65% | 98.95% |
CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 89.57% | 94.66% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.22% | 96.09% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 88.93% | 93.40% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.93% | 85.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.72% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.67% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.84% | 91.11% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.47% | 94.75% |
CHEMBL4235 | P28845 | 11-beta-hydroxysteroid dehydrogenase 1 | 82.39% | 97.98% |
CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 80.15% | 91.76% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Sophora franchetiana |
PubChem | 101648405 |
LOTUS | LTS0180729 |
wikiData | Q105276324 |