(2R,13bS)-2,11,12-trimethoxy-7-oxido-2,6,8,9-tetrahydro-1H-indolo[7a,1-a]isoquinolin-7-ium
| Internal ID | 8db6b760-fb03-471f-9a69-6442b5817a1d |
| Taxonomy | Alkaloids and derivatives > Erythrina alkaloids > Erythrinanes |
| IUPAC Name | (2R,13bS)-2,11,12-trimethoxy-7-oxido-2,6,8,9-tetrahydro-1H-indolo[7a,1-a]isoquinolin-7-ium |
| SMILES (Canonical) | COC1CC23C(=CC[N+]2(CCC4=CC(=C(C=C34)OC)OC)[O-])C=C1 |
| SMILES (Isomeric) | CO[C@@H]1C[C@@]23C(=CC[N+]2(CCC4=CC(=C(C=C34)OC)OC)[O-])C=C1 |
| InChI | InChI=1S/C19H23NO4/c1-22-15-5-4-14-7-9-20(21)8-6-13-10-17(23-2)18(24-3)11-16(13)19(14,20)12-15/h4-5,7,10-11,15H,6,8-9,12H2,1-3H3/t15-,19-,20?/m0/s1 |
| InChI Key | LAYFSBDIAGEQJD-YMNQCSKTSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16270821 g/mol |
| Topological Polar Surface Area (TPSA) | 45.80 Ų |
| XlogP | 1.60 |
| There are no found synonyms. |
![2D Structure of (2R,13bS)-2,11,12-trimethoxy-7-oxido-2,6,8,9-tetrahydro-1H-indolo[7a,1-a]isoquinolin-7-ium](https://plantaedb.com/storage/docs/compounds/2023/11/2r13bs-21112-trimethoxy-7-oxido-2689-tetrahydro-1h-indolo7a1-aisoquinolin-7-ium.jpg "2D Structure of (2R,13bS)-2,11,12-trimethoxy-7-oxido-2,6,8,9-tetrahydro-1H-indolo[7a,1-a]isoquinolin-7-ium")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.73% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.44% | 91.11% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 91.69% | 92.94% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.01% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.57% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.07% | 95.89% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 81.92% | 94.03% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.86% | 99.17% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.74% | 98.75% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.62% | 90.00% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.08% | 89.62% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 81.05% | 93.99% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.44% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Erythrina bidwillii |
| Erythrina herbacea |
| Erythrina leptorhiza |
| Erythrina lysistemon |
| PubChem | 101851986 |
| LOTUS | LTS0138116 |
| wikiData | Q104376027 |