(2R)-tetradeca-3,5-dien-2-amine
| Internal ID | 807c1f6f-564e-4a3d-a29f-7e6a5de7c26b |
| Taxonomy | Organic nitrogen compounds > Organonitrogen compounds > Amines > Primary amines > Monoalkylamines |
| IUPAC Name | (2R)-tetradeca-3,5-dien-2-amine |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C14H27N/c1-3-4-5-6-7-8-9-10-11-12-13-14(2)15/h10-14H,3-9,15H2,1-2H3/t14-/m1/s1 |
| InChI Key | WCUPLXASCCDKJN-CQSZACIVSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.37 g/mol |
| Exact Mass | 209.214349865 g/mol |
| Topological Polar Surface Area (TPSA) | 26.00 Ų |
| XlogP | 4.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 96.77% | 92.86% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 95.41% | 97.29% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.10% | 98.95% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 92.92% | 92.08% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 92.51% | 87.45% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 92.10% | 93.31% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 91.15% | 96.47% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.98% | 99.17% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 90.00% | 89.63% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.33% | 96.09% |
| CHEMBL236 | P41143 | Delta opioid receptor | 87.84% | 99.35% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.81% | 93.56% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.86% | 90.17% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 83.99% | 91.81% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 83.79% | 89.34% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.75% | 100.00% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 83.68% | 95.58% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.79% | 96.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.44% | 94.45% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 82.02% | 85.94% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 80.69% | 96.00% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 80.21% | 97.79% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163188609 |
| LOTUS | LTS0183209 |
| wikiData | Q105302098 |