(2R)-7-hydroxy-2-(4-hydroxyphenyl)-5-methoxy-2,3-dihydrochromen-4-one
Internal ID | 156f4b68-800a-4689-91b7-78b1bb61b821 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 5-O-methylated flavonoids |
IUPAC Name | (2R)-7-hydroxy-2-(4-hydroxyphenyl)-5-methoxy-2,3-dihydrochromen-4-one |
SMILES (Canonical) | COC1=CC(=CC2=C1C(=O)CC(O2)C3=CC=C(C=C3)O)O |
SMILES (Isomeric) | COC1=CC(=CC2=C1C(=O)C[C@@H](O2)C3=CC=C(C=C3)O)O |
InChI | InChI=1S/C16H14O5/c1-20-14-6-11(18)7-15-16(14)12(19)8-13(21-15)9-2-4-10(17)5-3-9/h2-7,13,17-18H,8H2,1H3/t13-/m1/s1 |
InChI Key | CWZLMWSCLBFCBY-CYBMUJFWSA-N |
Popularity | 0 references in papers |
Molecular Formula | C16H14O5 |
Molecular Weight | 286.28 g/mol |
Exact Mass | 286.08412354 g/mol |
Topological Polar Surface Area (TPSA) | 76.00 Ų |
XlogP | 2.20 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.02% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.98% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.52% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.93% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 90.11% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.95% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.87% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.41% | 97.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.91% | 99.23% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.84% | 89.00% |
CHEMBL2535 | P11166 | Glucose transporter | 87.40% | 98.75% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.28% | 90.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.57% | 94.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.45% | 99.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.06% | 95.89% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.24% | 90.71% |
CHEMBL4630 | O14757 | Serine/threonine-protein kinase Chk1 | 80.35% | 97.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Alpinia pinnanensis |
Alpinia roxburghii |
Boesenbergia rotunda |
PubChem | 40577064 |
LOTUS | LTS0220127 |
wikiData | Q104971703 |