(2R)-7-(3-methylbut-2-enoxy)-2-phenyl-2,3-dihydrochromen-4-one
| Internal ID | 189d0a22-8d88-419b-9b13-2d59bf4a388c |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > Flavanones |
| IUPAC Name | (2R)-7-(3-methylbut-2-enoxy)-2-phenyl-2,3-dihydrochromen-4-one |
| SMILES (Canonical) | CC(=CCOC1=CC2=C(C=C1)C(=O)CC(O2)C3=CC=CC=C3)C |
| SMILES (Isomeric) | CC(=CCOC1=CC2=C(C=C1)C(=O)C[C@@H](O2)C3=CC=CC=C3)C |
| InChI | InChI=1S/C20H20O3/c1-14(2)10-11-22-16-8-9-17-18(21)13-19(23-20(17)12-16)15-6-4-3-5-7-15/h3-10,12,19H,11,13H2,1-2H3/t19-/m1/s1 |
| InChI Key | GIXIYAFVCREOAY-LJQANCHMSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H20O3 |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.14124450 g/mol |
| Topological Polar Surface Area (TPSA) | 35.50 Ų |
| XlogP | 4.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.36% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.78% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.06% | 86.33% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 93.92% | 92.51% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.39% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.89% | 95.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.81% | 99.17% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.96% | 90.17% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 89.67% | 90.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.66% | 97.09% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.84% | 94.73% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.15% | 89.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.94% | 95.89% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.31% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Lonchocarpus sericeus |
| PubChem | 162847142 |
| LOTUS | LTS0162189 |
| wikiData | Q105009261 |