(2R)-3-(4-hydroxy-3-methoxyphenoxy)propane-1,2-diol
| Internal ID | 77316b2b-576b-4343-b1e0-fd8f324d0f95 |
| Taxonomy | Benzenoids > Phenols > Methoxyphenols |
| IUPAC Name | (2R)-3-(4-hydroxy-3-methoxyphenoxy)propane-1,2-diol |
| SMILES (Canonical) | COC1=C(C=CC(=C1)OCC(CO)O)O |
| SMILES (Isomeric) | COC1=C(C=CC(=C1)OC[C@@H](CO)O)O |
| InChI | InChI=1S/C10H14O5/c1-14-10-4-8(2-3-9(10)13)15-6-7(12)5-11/h2-4,7,11-13H,5-6H2,1H3/t7-/m1/s1 |
| InChI Key | KJEPCXJZFJTPAZ-SSDOTTSWSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.21 g/mol |
| Exact Mass | 214.08412354 g/mol |
| Topological Polar Surface Area (TPSA) | 79.20 Ų |
| XlogP | -0.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.65% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.80% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.01% | 99.17% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 94.00% | 99.15% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 92.92% | 90.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 90.06% | 98.75% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 89.87% | 93.31% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.74% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.01% | 86.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.55% | 96.00% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 87.60% | 89.62% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.71% | 95.56% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 85.09% | 86.92% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.65% | 98.95% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.34% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Pedicularis densispica |
| PubChem | 163012571 |
| LOTUS | LTS0240925 |
| wikiData | Q105141811 |