(2R)-2,3,3,5-tetramethyl-2H-furo[3,2-c]quinolin-4-one
| Internal ID | 2c79159d-544d-4345-a4c4-62803b8da50c |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Dihydrofuranoquinolines |
| IUPAC Name | (2R)-2,3,3,5-tetramethyl-2H-furo[3,2-c]quinolin-4-one |
| SMILES (Canonical) | CC1C(C2=C(O1)C3=CC=CC=C3N(C2=O)C)(C)C |
| SMILES (Isomeric) | C[C@@H]1C(C2=C(O1)C3=CC=CC=C3N(C2=O)C)(C)C |
| InChI | InChI=1S/C15H17NO2/c1-9-15(2,3)12-13(18-9)10-7-5-6-8-11(10)16(4)14(12)17/h5-9H,1-4H3/t9-/m1/s1 |
| InChI Key | JSJSVEVELHLLJW-SECBINFHSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.125928785 g/mol |
| Topological Polar Surface Area (TPSA) | 29.50 Ų |
| XlogP | 2.60 |
| There are no found synonyms. |
![2D Structure of (2R)-2,3,3,5-tetramethyl-2H-furo[3,2-c]quinolin-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/2r-2335-tetramethyl-2h-furo32-cquinolin-4-one.jpg "2D Structure of (2R)-2,3,3,5-tetramethyl-2H-furo[3,2-c]quinolin-4-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.86% | 95.56% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 94.38% | 93.99% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.56% | 98.95% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.50% | 99.23% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.31% | 89.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.17% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.65% | 85.14% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.32% | 86.33% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 87.17% | 90.08% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.72% | 97.25% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.71% | 97.14% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.12% | 94.00% |
| CHEMBL240 | Q12809 | HERG | 83.24% | 89.76% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 81.19% | 91.49% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 80.51% | 94.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Euxylophora paraensis |
| PubChem | 163193047 |
| LOTUS | LTS0107701 |
| wikiData | Q105134405 |