[(2R)-2,3-dihydroxypropyl] (2E,4E,6S)-6-methylocta-2,4-dienoate
| Internal ID | 7665e29e-dd47-4824-b38a-2d605b74b5ef |
| Taxonomy | Lipids and lipid-like molecules > Glycerolipids > Monoradylglycerols > Monoacylglycerols > 1-monoacylglycerols |
| IUPAC Name | [(2R)-2,3-dihydroxypropyl] (2E,4E,6S)-6-methylocta-2,4-dienoate |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C12H20O4/c1-3-10(2)6-4-5-7-12(15)16-9-11(14)8-13/h4-7,10-11,13-14H,3,8-9H2,1-2H3/b6-4+,7-5+/t10-,11+/m0/s1 |
| InChI Key | NOGDBKGCSWHQHI-SXAAAOJCSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.13615911 g/mol |
| Topological Polar Surface Area (TPSA) | 66.80 Ų |
| XlogP | 1.60 |
| There are no found synonyms. |
![2D Structure of [(2R)-2,3-dihydroxypropyl] (2E,4E,6S)-6-methylocta-2,4-dienoate](https://plantaedb.com/storage/docs/compounds/2023/11/2r-23-dihydroxypropyl-2e4e6s-6-methylocta-24-dienoate.jpg "2D Structure of [(2R)-2,3-dihydroxypropyl] (2E,4E,6S)-6-methylocta-2,4-dienoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.89% | 96.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 90.10% | 83.82% |
| CHEMBL202 | P00374 | Dihydrofolate reductase | 89.28% | 89.92% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.03% | 96.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.58% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.21% | 99.17% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 86.76% | 97.29% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 86.49% | 89.34% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 85.81% | 89.63% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 85.77% | 100.00% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.82% | 97.25% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.09% | 93.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.84% | 94.45% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.07% | 86.92% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 80.64% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 14705336 |
| LOTUS | LTS0209274 |
| wikiData | Q105182571 |