(2R)-2-chloro-N-phenylpropanamide
| Internal ID | a74ed25f-5423-4547-8732-c3fc9d596ec1 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Anilides |
| IUPAC Name | (2R)-2-chloro-N-phenylpropanamide |
| SMILES (Canonical) | CC(C(=O)NC1=CC=CC=C1)Cl |
| SMILES (Isomeric) | C[C@H](C(=O)NC1=CC=CC=C1)Cl |
| InChI | InChI=1S/C9H10ClNO/c1-7(10)9(12)11-8-5-3-2-4-6-8/h2-7H,1H3,(H,11,12)/t7-/m1/s1 |
| InChI Key | BWWXKHHVIAJJFM-SSDOTTSWSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C9H10ClNO |
| Molecular Weight | 183.63 g/mol |
| Exact Mass | 183.0450916 g/mol |
| Topological Polar Surface Area (TPSA) | 29.10 Ų |
| XlogP | 1.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.98% | 95.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.37% | 94.73% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.39% | 90.17% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 84.25% | 100.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.87% | 91.11% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.91% | 93.56% |
| CHEMBL1287628 | Q9Y5S8 | NADPH oxidase 1 | 81.65% | 95.48% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 81.60% | 94.23% |
| CHEMBL5028 | O14672 | ADAM10 | 81.31% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Huperzia serrata |
| PubChem | 2434811 |
| LOTUS | LTS0119331 |
| wikiData | Q104947717 |