(2R)-2-Amino-3-(carbamoylamino)oxypropanoic acid
| Internal ID | d7680af4-1a47-4eaf-a321-652c9a56c897 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives > Alpha amino acids > D-alpha-amino acids |
| IUPAC Name | (2R)-2-amino-3-(carbamoylamino)oxypropanoic acid |
| SMILES (Canonical) | C(C(C(=O)O)N)ONC(=O)N |
| SMILES (Isomeric) | C([C@H](C(=O)O)N)ONC(=O)N |
| InChI | InChI=1S/C4H9N3O4/c5-2(3(8)9)1-11-7-4(6)10/h2H,1,5H2,(H,8,9)(H3,6,7,10)/t2-/m1/s1 |
| InChI Key | ZFLDWYJOQSXISF-UWTATZPHSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C4H9N3O4 |
| Molecular Weight | 163.13 g/mol |
| Exact Mass | 163.05930578 g/mol |
| Topological Polar Surface Area (TPSA) | 128.00 Ų |
| XlogP | -4.60 |
| o-(carbamoylamino)-d-serine |
| (2R)-2-Amino-3-(carbamoylamino)oxypropanoic acid |
| 53459-31-7 |
| CHEBI:74212 |
| DTXSID401300106 |
| O-[(Aminocarbonyl)amino]-D-serine |
| NSC 163539 |
| C20651 |
| (2R)-2-Amino-3-[(carbamoylamino)oxy]propanoate |
| Q27144525 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.91% | 96.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 94.74% | 83.82% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 91.60% | 97.21% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 90.77% | 96.95% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 90.39% | 92.29% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.04% | 91.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.60% | 99.17% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.56% | 90.17% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 84.27% | 94.00% |
| CHEMBL233 | P35372 | Mu opioid receptor | 83.57% | 97.93% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 83.47% | 90.20% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.15% | 91.19% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.24% | 94.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 185742 |
| LOTUS | LTS0204704 |
| wikiData | Q27144525 |