(2R)-2-[(2S)-2-hydroxy-1-methoxy-5,6-dimethylhept-5-en-2-yl]-2,3-dihydro-1H-indole-5-carboxamide
| Internal ID | e0bbbd20-ebcc-4b82-808b-9c619dc8140e |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Indolecarboxylic acids and derivatives > Indolecarboxamides and derivatives |
| IUPAC Name | (2R)-2-[(2S)-2-hydroxy-1-methoxy-5,6-dimethylhept-5-en-2-yl]-2,3-dihydro-1H-indole-5-carboxamide |
| SMILES (Canonical) | CC(=C(C)CCC(COC)(C1CC2=C(N1)C=CC(=C2)C(=O)N)O)C |
| SMILES (Isomeric) | CC(=C(C)CC[C@@](COC)([C@H]1CC2=C(N1)C=CC(=C2)C(=O)N)O)C |
| InChI | InChI=1S/C19H28N2O3/c1-12(2)13(3)7-8-19(23,11-24-4)17-10-15-9-14(18(20)22)5-6-16(15)21-17/h5-6,9,17,21,23H,7-8,10-11H2,1-4H3,(H2,20,22)/t17-,19-/m1/s1 |
| InChI Key | OTZRBYNNRWOBRT-IEBWSBKVSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.20999276 g/mol |
| Topological Polar Surface Area (TPSA) | 84.60 Ų |
| XlogP | 2.90 |
| There are no found synonyms. |
![2D Structure of (2R)-2-[(2S)-2-hydroxy-1-methoxy-5,6-dimethylhept-5-en-2-yl]-2,3-dihydro-1H-indole-5-carboxamide](https://plantaedb.com/storage/docs/compounds/2023/11/2r-2-2s-2-hydroxy-1-methoxy-56-dimethylhept-5-en-2-yl-23-dihydro-1h-indole-5-carboxamide.jpg "2D Structure of (2R)-2-[(2S)-2-hydroxy-1-methoxy-5,6-dimethylhept-5-en-2-yl]-2,3-dihydro-1H-indole-5-carboxamide")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.72% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.34% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.17% | 97.09% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 94.34% | 92.68% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.96% | 97.25% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.52% | 98.95% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 92.50% | 97.21% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.42% | 86.33% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 90.69% | 96.95% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 90.66% | 90.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.49% | 99.17% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 90.47% | 92.94% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.54% | 95.89% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 83.93% | 93.18% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 82.90% | 94.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.41% | 98.75% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.39% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.92% | 95.56% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.05% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10382115 |
| LOTUS | LTS0222484 |
| wikiData | Q105199961 |