(2R)-2-(1,3-benzodioxol-5-yl)-2,3-dihydrofuro[2,3-h]chromen-4-one
| Internal ID | 0602b942-a552-4388-bc25-90ea12e7e045 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Furanoflavonoids and dihydrofuranoflavonoids |
| IUPAC Name | (2R)-2-(1,3-benzodioxol-5-yl)-2,3-dihydrofuro[2,3-h]chromen-4-one |
| SMILES (Canonical) | C1C(OC2=C(C1=O)C=CC3=C2C=CO3)C4=CC5=C(C=C4)OCO5 |
| SMILES (Isomeric) | C1[C@@H](OC2=C(C1=O)C=CC3=C2C=CO3)C4=CC5=C(C=C4)OCO5 |
| InChI | InChI=1S/C18H12O5/c19-13-8-16(10-1-3-15-17(7-10)22-9-21-15)23-18-11(13)2-4-14-12(18)5-6-20-14/h1-7,16H,8-9H2/t16-/m1/s1 |
| InChI Key | SXFFQMAXCHJUIA-MRXNPFEDSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H12O5 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.06847348 g/mol |
| Topological Polar Surface Area (TPSA) | 57.90 Ų |
| XlogP | 3.10 |
| There are no found synonyms. |
![2D Structure of (2R)-2-(1,3-benzodioxol-5-yl)-2,3-dihydrofuro[2,3-h]chromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/2r-2-13-benzodioxol-5-yl-23-dihydrofuro23-hchromen-4-one.jpg "2D Structure of (2R)-2-(1,3-benzodioxol-5-yl)-2,3-dihydrofuro[2,3-h]chromen-4-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 99.33% | 91.49% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.05% | 91.11% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 96.01% | 96.77% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 95.02% | 94.80% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 93.17% | 92.51% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.58% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.49% | 97.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.48% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.23% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.70% | 99.23% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 86.35% | 82.67% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.29% | 94.45% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.57% | 85.14% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.53% | 100.00% |
| CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 82.26% | 80.96% |
| CHEMBL2717 | Q9HCR9 | Phosphodiesterase 11A | 80.36% | 85.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Lonchocarpus heptaphyllus |
| PubChem | 163044678 |
| LOTUS | LTS0196366 |
| wikiData | Q105263093 |