[(3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[7-hydroxy-5-methyl-4-oxo-2-(2-oxopropyl)chromen-8-yl]oxan-3-yl] (E)-3-(4-hydroxyphenyl)prop-2-enoate
| Internal ID | d01005d4-0c62-4cf6-a0f2-e2bc03f39cce |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
| IUPAC Name | [(3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[7-hydroxy-5-methyl-4-oxo-2-(2-oxopropyl)chromen-8-yl]oxan-3-yl] (E)-3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES (Canonical) | CC1=CC(=C(C2=C1C(=O)C=C(O2)CC(=O)C)C3C(C(C(C(O3)CO)O)O)OC(=O)C=CC4=CC=C(C=C4)O)O |
| SMILES (Isomeric) | CC1=CC(=C(C2=C1C(=O)C=C(O2)CC(=O)C)C3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)OC(=O)/C=C/C4=CC=C(C=C4)O)O |
| InChI | InChI=1S/C28H28O11/c1-13-9-18(32)23(26-22(13)19(33)11-17(37-26)10-14(2)30)27-28(25(36)24(35)20(12-29)38-27)39-21(34)8-5-15-3-6-16(31)7-4-15/h3-9,11,20,24-25,27-29,31-32,35-36H,10,12H2,1-2H3/b8-5+/t20-,24-,25+,27?,28-/m1/s1 |
| InChI Key | QACRJXSXSVUOFZ-USHMAZDKSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C28H28O11 |
| Molecular Weight | 540.50 g/mol |
| Exact Mass | 540.16316171 g/mol |
| Topological Polar Surface Area (TPSA) | 180.00 Ų |
| XlogP | 1.00 |
| Atomic LogP (AlogP) | 1.42 |
| H-Bond Acceptor | 11 |
| H-Bond Donor | 5 |
| Rotatable Bonds | 7 |
| There are no found synonyms. |
![2D Structure of [(3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[7-hydroxy-5-methyl-4-oxo-2-(2-oxopropyl)chromen-8-yl]oxan-3-yl] (E)-3-(4-hydroxyphenyl)prop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/07/2fed5c10-2650-11ee-892d-29f103938430.jpg "2D Structure of [(3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[7-hydroxy-5-methyl-4-oxo-2-(2-oxopropyl)chromen-8-yl]oxan-3-yl] (E)-3-(4-hydroxyphenyl)prop-2-enoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.5601 | 56.01% |
| Caco-2 | - | 0.8742 | 87.42% |
| Blood Brain Barrier | - | 0.8000 | 80.00% |
| Human oral bioavailability | - | 0.7714 | 77.14% |
| Subcellular localzation | Mitochondria | 0.6183 | 61.83% |
| OATP2B1 inhibitior | - | 0.5639 | 56.39% |
| OATP1B1 inhibitior | + | 0.8406 | 84.06% |
| OATP1B3 inhibitior | + | 0.9650 | 96.50% |
| MATE1 inhibitior | - | 0.9600 | 96.00% |
| OCT2 inhibitior | - | 0.8250 | 82.50% |
| BSEP inhibitior | + | 0.9517 | 95.17% |
| P-glycoprotein inhibitior | + | 0.7000 | 70.00% |
| P-glycoprotein substrate | - | 0.6070 | 60.70% |
| CYP3A4 substrate | + | 0.6511 | 65.11% |
| CYP2C9 substrate | - | 0.7961 | 79.61% |
| CYP2D6 substrate | - | 0.8703 | 87.03% |
| CYP3A4 inhibition | - | 0.8664 | 86.64% |
| CYP2C9 inhibition | - | 0.8775 | 87.75% |
| CYP2C19 inhibition | - | 0.9044 | 90.44% |
| CYP2D6 inhibition | - | 0.9458 | 94.58% |
| CYP1A2 inhibition | - | 0.8699 | 86.99% |
| CYP2C8 inhibition | + | 0.7079 | 70.79% |
| CYP inhibitory promiscuity | - | 0.7766 | 77.66% |
| UGT catelyzed | - | 0.5000 | 50.00% |
| Carcinogenicity (binary) | - | 1.0000 | 100.00% |
| Carcinogenicity (trinary) | Non-required | 0.6917 | 69.17% |
| Eye corrosion | - | 0.9917 | 99.17% |
| Eye irritation | - | 0.9166 | 91.66% |
| Skin irritation | - | 0.8339 | 83.39% |
| Skin corrosion | - | 0.9518 | 95.18% |
| Ames mutagenesis | + | 0.5282 | 52.82% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7991 | 79.91% |
| Micronuclear | + | 0.6074 | 60.74% |
| Hepatotoxicity | - | 0.7416 | 74.16% |
| skin sensitisation | - | 0.8968 | 89.68% |
| Respiratory toxicity | + | 0.6000 | 60.00% |
| Reproductive toxicity | + | 0.8000 | 80.00% |
| Mitochondrial toxicity | + | 0.6000 | 60.00% |
| Nephrotoxicity | - | 0.8440 | 84.40% |
| Acute Oral Toxicity (c) | III | 0.5309 | 53.09% |
| Estrogen receptor binding | + | 0.7896 | 78.96% |
| Androgen receptor binding | + | 0.7476 | 74.76% |
| Thyroid receptor binding | - | 0.5144 | 51.44% |
| Glucocorticoid receptor binding | + | 0.6742 | 67.42% |
| Aromatase binding | - | 0.5675 | 56.75% |
| PPAR gamma | + | 0.6743 | 67.43% |
| Honey bee toxicity | - | 0.7453 | 74.53% |
| Biodegradation | - | 0.8750 | 87.50% |
| Crustacea aquatic toxicity | - | 0.6600 | 66.00% |
| Fish aquatic toxicity | + | 0.9768 | 97.68% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.52% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.72% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.20% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.14% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 94.94% | 94.73% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.56% | 95.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.10% | 99.17% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.79% | 96.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 88.12% | 96.95% |
| CHEMBL3194 | P02766 | Transthyretin | 86.87% | 90.71% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.00% | 95.50% |
| CHEMBL5678 | P34947 | G protein-coupled receptor kinase 5 | 83.25% | 88.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.22% | 99.15% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.59% | 97.09% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.56% | 95.89% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 80.04% | 91.71% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 80.01% | 90.93% |