[(2S,3R,4S,5S,6R)-4,5-dihydroxy-2-[3-hydroxy-2-[3-(4-hydroxyphenyl)propanoyl]-5-methoxyphenoxy]-6-(hydroxymethyl)oxan-3-yl] acetate
Internal ID | 2f7f78db-ef55-4bf8-bbf9-dbe5e5cb417d |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides |
IUPAC Name | [(2S,3R,4S,5S,6R)-4,5-dihydroxy-2-[3-hydroxy-2-[3-(4-hydroxyphenyl)propanoyl]-5-methoxyphenoxy]-6-(hydroxymethyl)oxan-3-yl] acetate |
SMILES (Canonical) | CC(=O)OC1C(C(C(OC1OC2=CC(=CC(=C2C(=O)CCC3=CC=C(C=C3)O)O)OC)CO)O)O |
SMILES (Isomeric) | CC(=O)O[C@@H]1[C@H]([C@@H]([C@H](O[C@H]1OC2=CC(=CC(=C2C(=O)CCC3=CC=C(C=C3)O)O)OC)CO)O)O |
InChI | InChI=1S/C24H28O11/c1-12(26)33-23-22(31)21(30)19(11-25)35-24(23)34-18-10-15(32-2)9-17(29)20(18)16(28)8-5-13-3-6-14(27)7-4-13/h3-4,6-7,9-10,19,21-25,27,29-31H,5,8,11H2,1-2H3/t19-,21-,22+,23-,24-/m1/s1 |
InChI Key | MLDPUOQFWOXHRX-PFKOEMKTSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C24H28O11 |
Molecular Weight | 492.50 g/mol |
Exact Mass | 492.16316171 g/mol |
Topological Polar Surface Area (TPSA) | 172.00 Ų |
XlogP | 1.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.75% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.45% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.35% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.37% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 94.05% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.62% | 94.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 92.27% | 94.73% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.55% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 90.49% | 90.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.19% | 86.33% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.96% | 95.50% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.38% | 95.56% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 86.08% | 85.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.84% | 95.89% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.80% | 96.95% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 85.27% | 86.92% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.49% | 96.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.56% | 89.00% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.33% | 97.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Pieris japonica |
Psorospermum adamauense |
Psorospermum glaberrimum |
Psorospermum tenuifolium |
PubChem | 11431848 |
LOTUS | LTS0149120 |
wikiData | Q104991203 |