2,8-dihydroxy-1-methoxy-6-methyl-10-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-10H-anthracen-9-one
Internal ID | 89a97e14-2bb3-4b07-80e7-4916054af9c3 |
Taxonomy | Benzenoids > Anthracenes |
IUPAC Name | 2,8-dihydroxy-1-methoxy-6-methyl-10-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-10H-anthracen-9-one |
SMILES (Canonical) | CC1=CC2=C(C(=C1)O)C(=O)C3=C(C2C4C(C(C(C(O4)CO)O)O)O)C=CC(=C3OC)O |
SMILES (Isomeric) | CC1=CC2=C(C(=C1)O)C(=O)C3=C(C2[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)C=CC(=C3OC)O |
InChI | InChI=1S/C22H24O9/c1-8-5-10-14(22-20(29)19(28)17(26)13(7-23)31-22)9-3-4-11(24)21(30-2)16(9)18(27)15(10)12(25)6-8/h3-6,13-14,17,19-20,22-26,28-29H,7H2,1-2H3/t13-,14?,17-,19+,20-,22+/m1/s1 |
InChI Key | RVKRJABUQLMQNO-FCURCJOESA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H24O9 |
Molecular Weight | 432.40 g/mol |
Exact Mass | 432.14203234 g/mol |
Topological Polar Surface Area (TPSA) | 157.00 Ų |
XlogP | 1.10 |
MEGxp0_001072 |
ACon0_000975 |
ACon1_000714 |
ACon1_002284 |
BRD-A51794763-001-02-6 |
![2D Structure of 2,8-dihydroxy-1-methoxy-6-methyl-10-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-10H-anthracen-9-one 2D Structure of 2,8-dihydroxy-1-methoxy-6-methyl-10-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-10H-anthracen-9-one](https://plantaedb.com/storage/docs/compounds/2023/11/2fe05040-83f0-11ee-b9d8-eb5b394d0939.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.97% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 94.31% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.21% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.51% | 94.73% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.02% | 96.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.20% | 99.15% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.14% | 89.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.91% | 94.45% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.92% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.97% | 86.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.07% | 99.23% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.18% | 96.00% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 82.62% | 93.18% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.05% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Aloe elgonica |
Aloe excelsa |
Aloe jacksonii |
Aloe speciosa |
Aloe yavellana |
PubChem | 23786315 |
LOTUS | LTS0218584 |
wikiData | Q104252910 |