(1E,3Z,6R,7R)-6-[2-[(2S)-2-hydroxy-5-oxo-2H-furan-4-yl]ethyl]-6,7-dimethyl-10-methylidenecyclodeca-1,3-diene-1-carboxylic acid
| Internal ID | 24261bc4-f340-4028-b9b3-05f47f9c6983 |
| Taxonomy | Organoheterocyclic compounds > Dihydrofurans > Furanones > Butenolides |
| IUPAC Name | (1E,3Z,6R,7R)-6-[2-[(2S)-2-hydroxy-5-oxo-2H-furan-4-yl]ethyl]-6,7-dimethyl-10-methylidenecyclodeca-1,3-diene-1-carboxylic acid |
| SMILES (Canonical) | CC1CCC(=C)C(=CC=CCC1(C)CCC2=CC(OC2=O)O)C(=O)O |
| SMILES (Isomeric) | C[C@@H]1CCC(=C)/C(=C\C=C/C[C@@]1(C)CCC2=C[C@H](OC2=O)O)/C(=O)O |
| InChI | InChI=1S/C20H26O5/c1-13-7-8-14(2)20(3,10-5-4-6-16(13)18(22)23)11-9-15-12-17(21)25-19(15)24/h4-6,12,14,17,21H,1,7-11H2,2-3H3,(H,22,23)/b5-4-,16-6+/t14-,17+,20+/m1/s1 |
| InChI Key | DYQVUHJGPRMPQI-WMUXPDSYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.17802393 g/mol |
| Topological Polar Surface Area (TPSA) | 83.80 Ų |
| XlogP | 4.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.57% | 91.11% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 95.98% | 83.82% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.46% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.93% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.38% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.81% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.60% | 86.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.44% | 99.23% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 85.01% | 89.05% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.64% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Croton megistocarpus |
| Pulicaria glutinosa |
| PubChem | 163040949 |
| LOTUS | LTS0072880 |
| wikiData | Q104991525 |