[(1S,3R,8S,9S,10R,13S,14S,17S)-17-[(1R)-1-[(2R)-4,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl]-1-hydroxyethyl]-1-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate
Internal ID | d969905b-436a-4721-8f7c-6c4d822a3de3 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid lactones > Withanolides and derivatives |
IUPAC Name | [(1S,3R,8S,9S,10R,13S,14S,17S)-17-[(1R)-1-[(2R)-4,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl]-1-hydroxyethyl]-1-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
SMILES (Canonical) | CC1=C(C(=O)OC(C1)C(C)(C2CCC3C2(CCC4C3CC=C5C4(C(CC(C5)OC(=O)C)O)C)C)O)C |
SMILES (Isomeric) | CC1=C(C(=O)O[C@H](C1)[C@@](C)([C@H]2CC[C@@H]3[C@@]2(CC[C@H]4[C@H]3CC=C5[C@@]4([C@H](C[C@@H](C5)OC(=O)C)O)C)C)O)C |
InChI | InChI=1S/C30H44O6/c1-16-13-26(36-27(33)17(16)2)30(6,34)24-10-9-22-21-8-7-19-14-20(35-18(3)31)15-25(32)29(19,5)23(21)11-12-28(22,24)4/h7,20-26,32,34H,8-15H2,1-6H3/t20-,21+,22+,23+,24+,25+,26-,28+,29+,30-/m1/s1 |
InChI Key | CYBYABMREZVKJT-RKCWJGHXSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H44O6 |
Molecular Weight | 500.70 g/mol |
Exact Mass | 500.31378912 g/mol |
Topological Polar Surface Area (TPSA) | 93.10 Ų |
XlogP | 4.60 |
There are no found synonyms. |
![2D Structure of [(1S,3R,8S,9S,10R,13S,14S,17S)-17-[(1R)-1-[(2R)-4,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl]-1-hydroxyethyl]-1-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate 2D Structure of [(1S,3R,8S,9S,10R,13S,14S,17S)-17-[(1R)-1-[(2R)-4,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl]-1-hydroxyethyl]-1-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/2f9093d0-85f8-11ee-b8f0-15948edc6618.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.23% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.19% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.00% | 89.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.86% | 100.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.71% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.70% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.37% | 86.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.87% | 99.23% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.63% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.71% | 94.45% |
CHEMBL1871 | P10275 | Androgen Receptor | 86.54% | 96.43% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.51% | 97.09% |
CHEMBL5028 | O14672 | ADAM10 | 86.44% | 97.50% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 86.40% | 97.33% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.04% | 93.56% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.62% | 97.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.49% | 91.11% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.43% | 94.75% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.06% | 96.95% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.36% | 91.19% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 84.28% | 93.04% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.57% | 94.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.72% | 91.07% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 82.50% | 90.08% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 81.52% | 95.71% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.66% | 94.73% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 80.29% | 97.79% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Eriolarynx australis |
PubChem | 15725474 |
LOTUS | LTS0180248 |
wikiData | Q104972236 |