(1S,12R,16S)-16-ethyl-15-methyl-11-methylidene-9,15-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraene
| Internal ID | d91c9691-bd92-4dc9-a5d2-6cc09bb0218c |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
| IUPAC Name | (1S,12R,16S)-16-ethyl-15-methyl-11-methylidene-9,15-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraene |
| SMILES (Canonical) | CCC1C2CCN(C1C3=C(C2=C)NC4=CC=CC=C43)C |
| SMILES (Isomeric) | CC[C@H]1[C@H]2CCN([C@@H]1C3=C(C2=C)NC4=CC=CC=C43)C |
| InChI | InChI=1S/C18H22N2/c1-4-12-13-9-10-20(3)18(12)16-14-7-5-6-8-15(14)19-17(16)11(13)2/h5-8,12-13,18-19H,2,4,9-10H2,1,3H3/t12-,13-,18-/m0/s1 |
| InChI Key | MFFIRXGJJPPAMA-LXIYXOSZSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H22N2 |
| Molecular Weight | 266.40 g/mol |
| Exact Mass | 266.178298710 g/mol |
| Topological Polar Surface Area (TPSA) | 19.00 Ų |
| XlogP | 3.50 |
| There are no found synonyms. |
![2D Structure of (1S,12R,16S)-16-ethyl-15-methyl-11-methylidene-9,15-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraene](https://plantaedb.com/storage/docs/compounds/2023/11/2f8d8020-8529-11ee-b85b-db2d0e05c0de.jpg "2D Structure of (1S,12R,16S)-16-ethyl-15-methyl-11-methylidene-9,15-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraene")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.82% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.14% | 98.95% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 94.99% | 98.59% |
| CHEMBL240 | Q12809 | HERG | 94.08% | 89.76% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.96% | 95.56% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.69% | 97.25% |
| CHEMBL228 | P31645 | Serotonin transporter | 90.79% | 95.51% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 90.55% | 93.99% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.47% | 97.09% |
| CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 87.89% | 90.71% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 83.93% | 89.62% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.36% | 90.17% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.36% | 95.89% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.16% | 90.00% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 82.03% | 97.50% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 81.93% | 88.56% |
| CHEMBL238 | Q01959 | Dopamine transporter | 81.53% | 95.88% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 80.97% | 87.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Aspidosperma subincanum |
| PubChem | 3034419 |
| LOTUS | LTS0143336 |
| wikiData | Q104395985 |