[(2S,3R,4S,5R,6S)-6-[(2S,3S,4R,5R,6S)-3-[(2S,3R,4S,5S,6S)-3,4-dihydroxy-6-methyl-5-[(2R)-2-methylbutanoyl]oxyoxan-2-yl]oxy-5-dodecanoyloxy-2-methyl-6-[[(1S,3R,4S,5R,6R,8R,10S,22S,23S,24S,26R)-4,5,26-trihydroxy-6,24-dimethyl-20-oxo-10-pentyl-2,7,9,21,25-pentaoxatricyclo[20.3.1.03,8]hexacosan-23-yl]oxy]oxan-4-yl]oxy-4,5-dihydroxy-2-methyloxan-3-yl] (11S)-11-[(2R,3R,4S,5R,6R)-3-[(2S,3R,4S,5R,6S)-5-[(2S,3R,4R,5S,6S)-5-[(2S,3R,4S,5R,6S)-3,4-dihydroxy-6-methyl-5-[(2R)-2-methylbutanoyl]oxyoxan-2-yl]oxy-3-dodecanoyloxy-6-methyl-4-[(1R,2R,3R,4S,5R)-2,3,4-trihydroxy-5-methylcyclohexyl]oxyoxan-2-yl]oxy-3,4-dihydroxy-6-methyloxan-2-yl]oxy-4,5-dihydroxy-6-methyloxan-2-yl]oxyhexadecanoate
Internal ID | 0b11db07-a673-46ce-a5cf-4335ca90f657 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
IUPAC Name | [(2S,3R,4S,5R,6S)-6-[(2S,3S,4R,5R,6S)-3-[(2S,3R,4S,5S,6S)-3,4-dihydroxy-6-methyl-5-[(2R)-2-methylbutanoyl]oxyoxan-2-yl]oxy-5-dodecanoyloxy-2-methyl-6-[[(1S,3R,4S,5R,6R,8R,10S,22S,23S,24S,26R)-4,5,26-trihydroxy-6,24-dimethyl-20-oxo-10-pentyl-2,7,9,21,25-pentaoxatricyclo[20.3.1.03,8]hexacosan-23-yl]oxy]oxan-4-yl]oxy-4,5-dihydroxy-2-methyloxan-3-yl] (11S)-11-[(2R,3R,4S,5R,6R)-3-[(2S,3R,4S,5R,6S)-5-[(2S,3R,4R,5S,6S)-5-[(2S,3R,4S,5R,6S)-3,4-dihydroxy-6-methyl-5-[(2R)-2-methylbutanoyl]oxyoxan-2-yl]oxy-3-dodecanoyloxy-6-methyl-4-[(1R,2R,3R,4S,5R)-2,3,4-trihydroxy-5-methylcyclohexyl]oxyoxan-2-yl]oxy-3,4-dihydroxy-6-methyloxan-2-yl]oxy-4,5-dihydroxy-6-methyloxan-2-yl]oxyhexadecanoate |
SMILES (Canonical) | CCCCCCCCCCCC(=O)OC1C(C(C(OC1OC2C(OC(C(C2O)O)OC3C(C(C(OC3OC(CCCCC)CCCCCCCCCC(=O)OC4C(OC(C(C4O)O)OC5C(C(OC(C5OC(=O)CCCCCCCCCCC)OC6C(OC7C(C6OC(=O)CCCCCCCCCC(OC8C(O7)C(C(C(O8)C)O)O)CCCCC)O)C)C)OC9C(C(C(C(O9)C)OC(=O)C(C)CC)O)O)C)C)O)O)C)C)OC1C(C(C(C(O1)C)OC(=O)C(C)CC)O)O)OC1CC(C(C(C1O)O)O)C |
SMILES (Isomeric) | CCCCCCCCCCCC(=O)O[C@@H]1[C@@H]([C@H]([C@@H](O[C@H]1O[C@H]2[C@@H](O[C@H]([C@@H]([C@@H]2O)O)O[C@@H]3[C@H]([C@H]([C@H](O[C@H]3O[C@@H](CCCCC)CCCCCCCCCC(=O)O[C@H]4[C@@H](O[C@H]([C@@H]([C@@H]4O)O)O[C@@H]5[C@H]([C@@H](O[C@H]([C@@H]5OC(=O)CCCCCCCCCCC)O[C@H]6[C@@H](O[C@@H]7[C@@H]([C@@H]6OC(=O)CCCCCCCCC[C@@H](O[C@H]8[C@H](O7)[C@H]([C@H]([C@H](O8)C)O)O)CCCCC)O)C)C)O[C@H]9[C@@H]([C@@H]([C@@H]([C@@H](O9)C)OC(=O)[C@H](C)CC)O)O)C)C)O)O)C)C)O[C@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)C)OC(=O)[C@H](C)CC)O)O)O[C@@H]1C[C@H]([C@@H]([C@H]([C@H]1O)O)O)C |
InChI | InChI=1S/C127H222O47/c1-19-25-29-31-33-35-41-47-57-65-85(130)164-115-113(161-82-67-70(9)87(132)91(136)90(82)135)108(169-119-99(144)95(140)104(74(13)153-119)166-117(148)68(7)23-5)78(17)157-126(115)168-106-76(15)155-121(101(146)97(106)142)172-111-92(137)88(133)71(10)150-124(111)159-80(59-51-27-21-3)61-53-45-39-37-43-49-55-63-83(128)162-103-73(12)152-122(98(143)94(103)139)174-114-109(170-120-100(145)96(141)105(75(14)154-120)167-118(149)69(8)24-6)79(18)158-127(116(114)165-86(131)66-58-48-42-36-34-32-30-26-20-2)171-107-77(16)156-123-102(147)110(107)163-84(129)64-56-50-44-38-40-46-54-62-81(60-52-28-22-4)160-125-112(173-123)93(138)89(134)72(11)151-125/h68-82,87-116,119-127,132-147H,19-67H2,1-18H3/t68-,69-,70-,71-,72-,73+,74+,75+,76+,77+,78+,79+,80+,81+,82-,87+,88+,89+,90+,91-,92+,93+,94+,95+,96+,97+,98-,99-,100-,101-,102-,103+,104+,105-,106+,107+,108+,109+,110+,111-,112-,113-,114-,115-,116-,119+,120+,121+,122+,123+,124+,125+,126+,127+/m1/s1 |
InChI Key | HKLDKRBGASBJRS-SYGNNDERSA-N |
Popularity | 0 references in papers |
Molecular Formula | C127H222O47 |
Molecular Weight | 2501.10 g/mol |
Exact Mass | 2500.5014990 g/mol |
Topological Polar Surface Area (TPSA) | 657.00 Ų |
XlogP | 17.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.23% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.58% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.42% | 96.09% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 97.03% | 92.50% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 96.85% | 95.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.97% | 99.17% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 94.85% | 100.00% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 94.54% | 96.38% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 94.31% | 93.56% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 93.88% | 96.47% |
CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 93.56% | 90.24% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 93.51% | 97.79% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 93.14% | 83.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 91.50% | 90.71% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 91.06% | 92.62% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.05% | 97.09% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 90.78% | 97.36% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.73% | 89.00% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 90.20% | 90.08% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.16% | 97.25% |
CHEMBL4072 | P07858 | Cathepsin B | 89.58% | 93.67% |
CHEMBL299 | P17252 | Protein kinase C alpha | 89.11% | 98.03% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.07% | 91.19% |
CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 87.38% | 96.25% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 87.01% | 98.75% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.97% | 95.89% |
CHEMBL1968 | P07099 | Epoxide hydrolase 1 | 86.36% | 98.57% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.95% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.19% | 86.33% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.91% | 95.50% |
CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 83.87% | 94.66% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.24% | 94.33% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 82.96% | 96.37% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.98% | 93.00% |
CHEMBL4105838 | Q96GG9 | DCN1-like protein 1 | 81.77% | 95.00% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 81.57% | 90.24% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 81.31% | 82.50% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 81.01% | 91.49% |
CHEMBL237 | P41145 | Kappa opioid receptor | 80.74% | 98.10% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 80.72% | 93.18% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 80.40% | 92.86% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.27% | 99.23% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.12% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ipomoea batatas |
PubChem | 162820120 |
LOTUS | LTS0157695 |
wikiData | Q103813548 |