(1R,2R)-1-[4-hydroxy-3-(2-hydroxy-5-prop-2-enylphenyl)phenyl]-3-[2-(2-hydroxy-5-prop-2-enylphenyl)-4-prop-2-enylphenoxy]propane-1,2-diol
Internal ID | ca786511-18f1-4af3-85ff-d6d146d86306 |
Taxonomy | Benzenoids > Benzene and substituted derivatives > Biphenyls and derivatives |
IUPAC Name | (1R,2R)-1-[4-hydroxy-3-(2-hydroxy-5-prop-2-enylphenyl)phenyl]-3-[2-(2-hydroxy-5-prop-2-enylphenyl)-4-prop-2-enylphenoxy]propane-1,2-diol |
SMILES (Canonical) | C=CCC1=CC(=C(C=C1)O)C2=C(C=CC(=C2)CC=C)OCC(C(C3=CC(=C(C=C3)O)C4=C(C=CC(=C4)CC=C)O)O)O |
SMILES (Isomeric) | C=CCC1=CC(=C(C=C1)O)C2=C(C=CC(=C2)CC=C)OC[C@H]([C@@H](C3=CC(=C(C=C3)O)C4=C(C=CC(=C4)CC=C)O)O)O |
InChI | InChI=1S/C36H36O6/c1-4-7-23-10-14-31(37)27(18-23)29-21-26(13-16-33(29)39)36(41)34(40)22-42-35-17-12-25(9-6-3)20-30(35)28-19-24(8-5-2)11-15-32(28)38/h4-6,10-21,34,36-41H,1-3,7-9,22H2/t34-,36-/m1/s1 |
InChI Key | FVWZTCBBMRXVFJ-QZCRLSDHSA-N |
Popularity | 0 references in papers |
Molecular Formula | C36H36O6 |
Molecular Weight | 564.70 g/mol |
Exact Mass | 564.25118886 g/mol |
Topological Polar Surface Area (TPSA) | 110.00 Ų |
XlogP | 7.50 |
There are no found synonyms. |
![2D Structure of (1R,2R)-1-[4-hydroxy-3-(2-hydroxy-5-prop-2-enylphenyl)phenyl]-3-[2-(2-hydroxy-5-prop-2-enylphenyl)-4-prop-2-enylphenoxy]propane-1,2-diol 2D Structure of (1R,2R)-1-[4-hydroxy-3-(2-hydroxy-5-prop-2-enylphenyl)phenyl]-3-[2-(2-hydroxy-5-prop-2-enylphenyl)-4-prop-2-enylphenoxy]propane-1,2-diol](https://plantaedb.com/storage/docs/compounds/2023/11/2f42f1a0-8615-11ee-bef8-6307ac494bd6.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.34% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 95.72% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.24% | 91.11% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 93.13% | 90.24% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.01% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.47% | 99.17% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 92.27% | 95.17% |
CHEMBL4208 | P20618 | Proteasome component C5 | 90.56% | 90.00% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 90.05% | 90.20% |
CHEMBL240 | Q12809 | HERG | 89.11% | 89.76% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 88.33% | 83.57% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.84% | 99.15% |
CHEMBL3194 | P02766 | Transthyretin | 87.07% | 90.71% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.38% | 94.73% |
CHEMBL210 | P07550 | Beta-2 adrenergic receptor | 86.28% | 96.90% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 85.72% | 97.21% |
CHEMBL2535 | P11166 | Glucose transporter | 85.37% | 98.75% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.32% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.52% | 95.89% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.44% | 96.95% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.30% | 95.50% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.36% | 95.56% |
CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 81.71% | 93.81% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.70% | 96.00% |
CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 80.13% | 95.34% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Magnolia officinalis |
PubChem | 162872262 |
LOTUS | LTS0151196 |
wikiData | Q105367355 |