N-[3-hydroxy-6-(19-hydroxy-12-oxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17(22),18,20-nonaen-3-yl)-2-methyloxan-4-yl]acetamide
| Internal ID | d0784ea0-9f60-4dab-a8d6-59fab08d5553 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles > Pyrrolocarbazoles > Indolocarbazoles |
| IUPAC Name | N-[3-hydroxy-6-(19-hydroxy-12-oxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17(22),18,20-nonaen-3-yl)-2-methyloxan-4-yl]acetamide |
| SMILES (Canonical) | CC1C(C(CC(O1)N2C3=CC=CC=C3C4=C5C(=C6C7=C(C=CC(=C7)O)NC6=C42)CNC5=O)NC(=O)C)O |
| SMILES (Isomeric) | CC1C(C(CC(O1)N2C3=CC=CC=C3C4=C5C(=C6C7=C(C=CC(=C7)O)NC6=C42)CNC5=O)NC(=O)C)O |
| InChI | InChI=1S/C28H26N4O5/c1-12-27(35)19(30-13(2)33)10-21(37-12)32-20-6-4-3-5-15(20)23-24-17(11-29-28(24)36)22-16-9-14(34)7-8-18(16)31-25(22)26(23)32/h3-9,12,19,21,27,31,34-35H,10-11H2,1-2H3,(H,29,36)(H,30,33) |
| InChI Key | AHSYSYIIGPUCMY-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C28H26N4O5 |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 498.19031994 g/mol |
| Topological Polar Surface Area (TPSA) | 129.00 Ų |
| XlogP | 2.50 |
| Atomic LogP (AlogP) | 3.55 |
| H-Bond Acceptor | 6 |
| H-Bond Donor | 5 |
| Rotatable Bonds | 2 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.6608 | 66.08% |
| Caco-2 | - | 0.8631 | 86.31% |
| Blood Brain Barrier | - | 0.6250 | 62.50% |
| Human oral bioavailability | - | 0.7286 | 72.86% |
| Subcellular localzation | Nucleus | 0.4414 | 44.14% |
| OATP2B1 inhibitior | - | 0.7141 | 71.41% |
| OATP1B1 inhibitior | + | 0.8259 | 82.59% |
| OATP1B3 inhibitior | + | 0.9378 | 93.78% |
| MATE1 inhibitior | - | 0.7809 | 78.09% |
| OCT2 inhibitior | - | 0.8956 | 89.56% |
| BSEP inhibitior | + | 0.9426 | 94.26% |
| P-glycoprotein inhibitior | + | 0.7290 | 72.90% |
| P-glycoprotein substrate | + | 0.8222 | 82.22% |
| CYP3A4 substrate | + | 0.6985 | 69.85% |
| CYP2C9 substrate | - | 0.8024 | 80.24% |
| CYP2D6 substrate | - | 0.8424 | 84.24% |
| CYP3A4 inhibition | - | 0.9332 | 93.32% |
| CYP2C9 inhibition | - | 0.6666 | 66.66% |
| CYP2C19 inhibition | - | 0.8301 | 83.01% |
| CYP2D6 inhibition | - | 0.8877 | 88.77% |
| CYP1A2 inhibition | - | 0.8843 | 88.43% |
| CYP2C8 inhibition | + | 0.7045 | 70.45% |
| CYP inhibitory promiscuity | - | 0.8072 | 80.72% |
| UGT catelyzed | - | 0.5000 | 50.00% |
| Carcinogenicity (binary) | - | 0.8800 | 88.00% |
| Carcinogenicity (trinary) | Non-required | 0.5841 | 58.41% |
| Eye corrosion | - | 0.9908 | 99.08% |
| Eye irritation | - | 0.9803 | 98.03% |
| Skin irritation | - | 0.8084 | 80.84% |
| Skin corrosion | - | 0.9447 | 94.47% |
| Ames mutagenesis | + | 0.6400 | 64.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6737 | 67.37% |
| Micronuclear | + | 0.8800 | 88.00% |
| Hepatotoxicity | + | 0.6125 | 61.25% |
| skin sensitisation | - | 0.8968 | 89.68% |
| Respiratory toxicity | + | 0.8222 | 82.22% |
| Reproductive toxicity | + | 0.9667 | 96.67% |
| Mitochondrial toxicity | + | 0.8625 | 86.25% |
| Nephrotoxicity | - | 0.7362 | 73.62% |
| Acute Oral Toxicity (c) | III | 0.6260 | 62.60% |
| Estrogen receptor binding | + | 0.7362 | 73.62% |
| Androgen receptor binding | + | 0.7121 | 71.21% |
| Thyroid receptor binding | + | 0.5389 | 53.89% |
| Glucocorticoid receptor binding | + | 0.7325 | 73.25% |
| Aromatase binding | - | 0.5749 | 57.49% |
| PPAR gamma | + | 0.7418 | 74.18% |
| Honey bee toxicity | - | 0.7808 | 78.08% |
| Biodegradation | - | 0.9000 | 90.00% |
| Crustacea aquatic toxicity | - | 0.5100 | 51.00% |
| Fish aquatic toxicity | - | 0.4543 | 45.43% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL299 | P17252 | Protein kinase C alpha |
97 nM |
IC50 |
via Super-PRED
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.66% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.22% | 85.14% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 99.19% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.71% | 98.95% |
| CHEMBL2708 | Q16584 | Mitogen-activated protein kinase kinase kinase 11 | 98.51% | 81.14% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.18% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.48% | 96.09% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 96.66% | 98.59% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 96.49% | 95.64% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 95.71% | 83.10% |
| CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 95.62% | 87.16% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 95.14% | 85.11% |
| CHEMBL4924 | Q9UK32 | Ribosomal protein S6 kinase alpha 6 | 95.01% | 80.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.78% | 95.56% |
| CHEMBL4630 | O14757 | Serine/threonine-protein kinase Chk1 | 94.34% | 97.03% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 93.47% | 96.39% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 92.94% | 91.79% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 92.81% | 93.99% |
| CHEMBL2535 | P11166 | Glucose transporter | 92.61% | 98.75% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 92.11% | 80.71% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.04% | 99.23% |
| CHEMBL3788 | O00444 | Serine/threonine-protein kinase PLK4 | 91.95% | 83.65% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 91.46% | 90.08% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 91.23% | 93.10% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 90.57% | 91.49% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 90.44% | 96.00% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 89.85% | 89.44% |
| CHEMBL4599 | Q07912 | Tyrosine kinase non-receptor protein 2 | 89.16% | 94.29% |
| CHEMBL4578 | Q14680 | Maternal embryonic leucine zipper kinase | 88.89% | 81.58% |
| CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 88.48% | 80.00% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 88.41% | 92.67% |
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 88.38% | 93.24% |
| CHEMBL5678 | P34947 | G protein-coupled receptor kinase 5 | 87.90% | 88.00% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 87.13% | 94.45% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 87.12% | 91.38% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 85.71% | 93.03% |
| CHEMBL279 | P35968 | Vascular endothelial growth factor receptor 2 | 84.06% | 95.52% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.48% | 90.00% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 83.46% | 97.00% |
| CHEMBL5408 | Q9UHD2 | Serine/threonine-protein kinase TBK1 | 82.52% | 90.48% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.51% | 94.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.51% | 97.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.96% | 95.89% |
| CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 80.83% | 80.96% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.40% | 94.73% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.10% | 99.17% |
| CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 80.02% | 89.23% |
| CHEMBL3234 | P08631 | Tyrosine-protein kinase HCK | 80.01% | 88.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162815706 |
| LOTUS | LTS0158043 |
| wikiData | Q103816128 |