(2E,9Z)-N-(2-hydroxy-2-methylpropyl)pentadeca-2,9-dien-12,14-diynamide
| Internal ID | 30ae2bfb-d0c5-4282-9eb8-dd97a52f6573 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty amides > N-acyl amines |
| IUPAC Name | (2E,9Z)-N-(2-hydroxy-2-methylpropyl)pentadeca-2,9-dien-12,14-diynamide |
| SMILES (Canonical) | CC(C)(CNC(=O)C=CCCCCCC=CCC#CC#C)O |
| SMILES (Isomeric) | CC(C)(CNC(=O)/C=C/CCCCC/C=C\CC#CC#C)O |
| InChI | InChI=1S/C19H27NO2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-18(21)20-17-19(2,3)22/h1,8-9,15-16,22H,7,10-14,17H2,2-3H3,(H,20,21)/b9-8-,16-15+ |
| InChI Key | SMIMDPKWDHJDGC-ZHEVCFECSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H27NO2 |
| Molecular Weight | 301.40 g/mol |
| Exact Mass | 301.204179104 g/mol |
| Topological Polar Surface Area (TPSA) | 49.30 Ų |
| XlogP | 3.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 94.77% | 98.95% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 94.12% | 89.34% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.03% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.89% | 96.09% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 88.22% | 89.63% |
| CHEMBL4179 | P45984 | c-Jun N-terminal kinase 2 | 86.13% | 90.75% |
| CHEMBL5251 | Q06187 | Tyrosine-protein kinase BTK | 85.46% | 98.51% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 85.33% | 100.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.45% | 94.73% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.38% | 91.11% |
| CHEMBL3975 | P09467 | Fructose-1,6-bisphosphatase | 83.15% | 92.95% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.77% | 90.17% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.95% | 94.33% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.12% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Echinacea purpurea |
| PubChem | 50915954 |
| LOTUS | LTS0229596 |
| wikiData | Q105255956 |