(2E,9Z)-1-piperidin-1-yloctadeca-2,9-dien-12-yn-1-one
Internal ID | c67f6b82-6801-44e2-99f6-5b6200db98e2 |
Taxonomy | Organoheterocyclic compounds > Piperidines > N-acylpiperidines |
IUPAC Name | (2E,9Z)-1-piperidin-1-yloctadeca-2,9-dien-12-yn-1-one |
SMILES (Canonical) | CCCCCC#CCC=CCCCCCC=CC(=O)N1CCCCC1 |
SMILES (Isomeric) | CCCCCC#CC/C=C\CCCCC/C=C/C(=O)N1CCCCC1 |
InChI | InChI=1S/C23H37NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-17-20-23(25)24-21-18-16-19-22-24/h9-10,17,20H,2-5,8,11-16,18-19,21-22H2,1H3/b10-9-,20-17+ |
InChI Key | LDHDTTXXQAKQST-OJCXWOIGSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H37NO |
Molecular Weight | 343.50 g/mol |
Exact Mass | 343.287514804 g/mol |
Topological Polar Surface Area (TPSA) | 20.30 Ų |
XlogP | 7.00 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL230 | P35354 | Cyclooxygenase-2 | 99.06% | 89.63% |
CHEMBL2581 | P07339 | Cathepsin D | 97.32% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.07% | 96.09% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 94.65% | 91.81% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 94.59% | 92.86% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.18% | 99.17% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 89.91% | 100.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 88.35% | 90.17% |
CHEMBL1781 | P11387 | DNA topoisomerase I | 86.58% | 97.00% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 86.46% | 92.08% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.24% | 95.50% |
CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 84.90% | 96.25% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 83.61% | 96.38% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.43% | 94.33% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 82.56% | 83.57% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.11% | 90.71% |
CHEMBL4660 | P28907 | Lymphocyte differentiation antigen CD38 | 81.88% | 95.27% |
CHEMBL3105 | P09874 | Poly [ADP-ribose] polymerase-1 | 80.12% | 93.90% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Achillea chamaemelifolia |
PubChem | 13846791 |
LOTUS | LTS0055722 |
wikiData | Q105150217 |