(5S)-5-methoxy-2-[(3E,5E,7E,9E,11E,13E,15E)-18-[(4S)-4-methoxy-2,6,6-trimethylcyclohexen-1-yl]-3,7,12,16-tetramethyloctadeca-3,5,7,9,11,13,15-heptaen-1,17-diynyl]-1,3,3-trimethylcyclohexene
| Internal ID | b528c4a3-350f-4cf1-a14b-d07c0abb872d |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
| IUPAC Name | (5S)-5-methoxy-2-[(3E,5E,7E,9E,11E,13E,15E)-18-[(4S)-4-methoxy-2,6,6-trimethylcyclohexen-1-yl]-3,7,12,16-tetramethyloctadeca-3,5,7,9,11,13,15-heptaen-1,17-diynyl]-1,3,3-trimethylcyclohexene |
| SMILES (Canonical) | CC1=C(C(CC(C1)OC)(C)C)C#CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C#CC2=C(CC(CC2(C)C)OC)C)C)C |
| SMILES (Isomeric) | CC1=C(C(C[C@H](C1)OC)(C)C)C#C/C(=C/C=C/C(=C/C=C/C=C(/C=C/C=C(/C#CC2=C(C[C@@H](CC2(C)C)OC)C)\C)\C)/C)/C |
| InChI | InChI=1S/C42H56O2/c1-31(19-15-21-33(3)23-25-39-35(5)27-37(43-11)29-41(39,7)8)17-13-14-18-32(2)20-16-22-34(4)24-26-40-36(6)28-38(44-12)30-42(40,9)10/h13-22,37-38H,27-30H2,1-12H3/b14-13+,19-15+,20-16+,31-17+,32-18+,33-21+,34-22+/t37-,38-/m0/s1 |
| InChI Key | AISMWPSTESEVLG-FJYHSFPJSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C42H56O2 |
| Molecular Weight | 592.90 g/mol |
| Exact Mass | 592.42803102 g/mol |
| Topological Polar Surface Area (TPSA) | 18.50 Ų |
| XlogP | 11.50 |
| There are no found synonyms. |
![2D Structure of (5S)-5-methoxy-2-[(3E,5E,7E,9E,11E,13E,15E)-18-[(4S)-4-methoxy-2,6,6-trimethylcyclohexen-1-yl]-3,7,12,16-tetramethyloctadeca-3,5,7,9,11,13,15-heptaen-1,17-diynyl]-1,3,3-trimethylcyclohexene](https://plantaedb.com/storage/docs/compounds/2023/11/2e9ec7e0-8689-11ee-9136-a39d89305922.jpg "2D Structure of (5S)-5-methoxy-2-[(3E,5E,7E,9E,11E,13E,15E)-18-[(4S)-4-methoxy-2,6,6-trimethylcyclohexen-1-yl]-3,7,12,16-tetramethyloctadeca-3,5,7,9,11,13,15-heptaen-1,17-diynyl]-1,3,3-trimethylcyclohexene")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.37% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.85% | 91.11% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 93.77% | 92.94% |
| CHEMBL1870 | P28702 | Retinoid X receptor beta | 87.64% | 95.00% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 86.74% | 97.79% |
| CHEMBL2004 | P48443 | Retinoid X receptor gamma | 86.31% | 100.00% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 86.24% | 90.24% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.03% | 94.75% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 85.73% | 91.71% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 85.56% | 97.47% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.50% | 95.89% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 82.46% | 91.49% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.89% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.64% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.12% | 95.56% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.08% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162933240 |
| LOTUS | LTS0119987 |
| wikiData | Q104912948 |