(2S,4S,5S)-2-[3-hydroxy-5-[(Z)-2-(4-hydroxyphenyl)ethenyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol
Internal ID | 6f8d4f50-1469-448e-9d49-8e51ae07b244 |
Taxonomy | Phenylpropanoids and polyketides > Stilbenes > Stilbene glycosides |
IUPAC Name | (2S,4S,5S)-2-[3-hydroxy-5-[(Z)-2-(4-hydroxyphenyl)ethenyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | C1=CC(=CC=C1C=CC2=CC(=CC(=C2)OC3C(C(C(C(O3)CO)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1/C=C\C2=CC(=CC(=C2)O[C@H]3C([C@H]([C@@H](C(O3)CO)O)O)O)O)O |
InChI | InChI=1S/C20H22O8/c21-10-16-17(24)18(25)19(26)20(28-16)27-15-8-12(7-14(23)9-15)2-1-11-3-5-13(22)6-4-11/h1-9,16-26H,10H2/b2-1-/t16?,17-,18+,19?,20-/m1/s1 |
InChI Key | HSTZMXCBWJGKHG-MWQIQHPGSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H22O8 |
Molecular Weight | 390.40 g/mol |
Exact Mass | 390.13146766 g/mol |
Topological Polar Surface Area (TPSA) | 140.00 Ų |
XlogP | 1.70 |
There are no found synonyms. |
![2D Structure of (2S,4S,5S)-2-[3-hydroxy-5-[(Z)-2-(4-hydroxyphenyl)ethenyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol 2D Structure of (2S,4S,5S)-2-[3-hydroxy-5-[(Z)-2-(4-hydroxyphenyl)ethenyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/2e977120-83a6-11ee-8aa5-1d28daddb0e9.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.04% | 91.11% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.84% | 96.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 92.79% | 95.93% |
CHEMBL3194 | P02766 | Transthyretin | 92.41% | 90.71% |
CHEMBL3401 | O75469 | Pregnane X receptor | 92.04% | 94.73% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 89.95% | 98.35% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.29% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.07% | 86.33% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 87.54% | 86.92% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.78% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.76% | 95.56% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 85.48% | 91.71% |
CHEMBL2581 | P07339 | Cathepsin D | 85.39% | 98.95% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.11% | 95.89% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.90% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.88% | 99.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.68% | 95.89% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 82.36% | 89.67% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 80.52% | 85.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Vitis vinifera |
PubChem | 163187438 |
LOTUS | LTS0203249 |
wikiData | Q105033281 |