1,8b-dihydroxy-3a-(3-hydroxy-4-methoxyphenyl)-6,8-dimethoxy-N,N-dimethyl-3-phenyl-1,2,3,4-tetrahydrocyclopenta[a]indene-2-carboxamide
Internal ID | 3e19b991-9cd4-431d-9fea-1f04e44f4b5d |
Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
IUPAC Name | 1,8b-dihydroxy-3a-(3-hydroxy-4-methoxyphenyl)-6,8-dimethoxy-N,N-dimethyl-3-phenyl-1,2,3,4-tetrahydrocyclopenta[a]indene-2-carboxamide |
SMILES (Canonical) | CN(C)C(=O)C1C(C2(CC3=C(C2(C1O)O)C(=CC(=C3)OC)OC)C4=CC(=C(C=C4)OC)O)C5=CC=CC=C5 |
SMILES (Isomeric) | CN(C)C(=O)C1C(C2(CC3=C(C2(C1O)O)C(=CC(=C3)OC)OC)C4=CC(=C(C=C4)OC)O)C5=CC=CC=C5 |
InChI | InChI=1S/C30H33NO7/c1-31(2)28(34)24-26(17-9-7-6-8-10-17)29(19-11-12-22(37-4)21(32)14-19)16-18-13-20(36-3)15-23(38-5)25(18)30(29,35)27(24)33/h6-15,24,26-27,32-33,35H,16H2,1-5H3 |
InChI Key | MDUKNOYAUGMJTB-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H33NO7 |
Molecular Weight | 519.60 g/mol |
Exact Mass | 519.22570239 g/mol |
Topological Polar Surface Area (TPSA) | 109.00 Ų |
XlogP | 3.20 |
There are no found synonyms. |
![2D Structure of 1,8b-dihydroxy-3a-(3-hydroxy-4-methoxyphenyl)-6,8-dimethoxy-N,N-dimethyl-3-phenyl-1,2,3,4-tetrahydrocyclopenta[a]indene-2-carboxamide 2D Structure of 1,8b-dihydroxy-3a-(3-hydroxy-4-methoxyphenyl)-6,8-dimethoxy-N,N-dimethyl-3-phenyl-1,2,3,4-tetrahydrocyclopenta[a]indene-2-carboxamide](https://plantaedb.com/storage/docs/compounds/2023/11/2e617730-8841-11ee-acd9-8791834f21e5.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.17% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.42% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.67% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 91.71% | 98.95% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 90.78% | 91.19% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.46% | 86.33% |
CHEMBL240 | Q12809 | HERG | 87.74% | 89.76% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.45% | 97.14% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.62% | 99.23% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.17% | 89.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.06% | 91.07% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.05% | 95.89% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.61% | 94.00% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 83.61% | 97.33% |
CHEMBL2535 | P11166 | Glucose transporter | 83.52% | 98.75% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.82% | 96.00% |
CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 82.30% | 100.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.99% | 99.15% |
CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 80.69% | 85.49% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Aglaia odorata |
PubChem | 162867224 |
LOTUS | LTS0196938 |
wikiData | Q105161959 |