[(2S,3S,4R,5R,6S)-2-[[(4S,4aR,10aS,11bS)-4,8,11b-trimethyl-7,9-dioxo-1,2,3,4a,5,6,10a,11-octahydronaphtho[2,1-f][1]benzofuran-4-yl]methoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] 4-hydroxy-3,5-dimethoxybenzoate
Internal ID | 07940918-ee40-4d8a-b7c3-6f9cf5e3f7f5 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Diterpene glycosides |
IUPAC Name | [(2S,3S,4R,5R,6S)-2-[[(4S,4aR,10aS,11bS)-4,8,11b-trimethyl-7,9-dioxo-1,2,3,4a,5,6,10a,11-octahydronaphtho[2,1-f][1]benzofuran-4-yl]methoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] 4-hydroxy-3,5-dimethoxybenzoate |
SMILES (Canonical) | CC1=C2C(CC3=C(C2=O)CCC4C3(CCCC4(C)COC5C(C(C(C(O5)CO)O)O)OC(=O)C6=CC(=C(C(=C6)OC)O)OC)C)OC1=O |
SMILES (Isomeric) | CC1=C2[C@H](CC3=C(C2=O)CC[C@@H]4[C@@]3(CCC[C@]4(C)CO[C@@H]5[C@H]([C@@H]([C@H]([C@@H](O5)CO)O)O)OC(=O)C6=CC(=C(C(=C6)OC)O)OC)C)OC1=O |
InChI | InChI=1S/C35H44O13/c1-16-25-20(46-31(16)41)13-19-18(26(25)37)7-8-24-34(2,9-6-10-35(19,24)3)15-45-33-30(29(40)28(39)23(14-36)47-33)48-32(42)17-11-21(43-4)27(38)22(12-17)44-5/h11-12,20,23-24,28-30,33,36,38-40H,6-10,13-15H2,1-5H3/t20-,23-,24-,28-,29+,30-,33-,34+,35+/m0/s1 |
InChI Key | MPXLWWDEWZKMBC-CSRMIFBYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C35H44O13 |
Molecular Weight | 672.70 g/mol |
Exact Mass | 672.27819145 g/mol |
Topological Polar Surface Area (TPSA) | 188.00 Ų |
XlogP | 3.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.82% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 96.22% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.35% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.24% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 94.01% | 95.89% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.49% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.39% | 89.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 90.33% | 92.94% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 90.01% | 92.50% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.79% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.19% | 100.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.59% | 92.62% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.75% | 94.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.27% | 99.23% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 84.14% | 86.92% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 84.02% | 97.33% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.78% | 91.19% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.50% | 99.17% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 82.70% | 82.38% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.20% | 91.07% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.17% | 97.14% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.88% | 96.00% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 80.86% | 96.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.39% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Phlogacanthus curviflorus |
PubChem | 163037582 |
LOTUS | LTS0164790 |
wikiData | Q105169794 |